2-tert-butoxy-2-(1,3-di(chroman-6-yl)isoquinolin-4-yl)acetic acid

ID: ALA4527313

PubChem CID: 146000649

Max Phase: Preclinical

Molecular Formula: C33H33NO5

Molecular Weight: 523.63

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)(C)OC(C(=O)O)c1c(-c2ccc3c(c2)CCCO3)nc(-c2ccc3c(c2)CCCO3)c2ccccc12

Standard InChI:  InChI=1S/C33H33NO5/c1-33(2,3)39-31(32(35)36)28-24-10-4-5-11-25(24)29(22-12-14-26-20(18-22)8-6-16-37-26)34-30(28)23-13-15-27-21(19-23)9-7-17-38-27/h4-5,10-15,18-19,31H,6-9,16-17H2,1-3H3,(H,35,36)

Standard InChI Key:  FXHPWCDDCUFQBC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 39 44  0  0  0  0  0  0  0  0999 V2000
   33.9863   -4.0983    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.9852   -4.9178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4000   -4.0947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6914   -3.6894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4029   -4.9174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6924   -5.3246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6909   -6.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3991   -6.5525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1103   -6.1402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1083   -5.3245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1062   -3.6834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8154   -4.0894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1031   -2.8663    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.8093   -2.4550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8062   -1.6378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5185   -2.8609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5124   -2.0389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8185   -4.9066    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.5216   -3.6781    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.2801   -5.3268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5721   -4.9166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8649   -5.3245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2815   -6.1406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6862   -2.8751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3943   -2.4650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3922   -1.6486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9795   -2.4714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9739   -1.6564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6784   -1.2406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6707   -0.4271    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.9600   -0.0232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2555   -0.4390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2617   -1.2586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5773   -6.5510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8631   -6.1388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1531   -6.5489    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.1509   -7.3728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8651   -7.7850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5814   -7.3732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  6  1  0
  5  3  1  0
  3  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  5  2  0
  3 11  1  0
 11 12  1  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  0
 14 17  1  0
 12 18  2  0
 12 19  1  0
 20 21  2  0
 21 22  1  0
 22 35  2  0
 34 23  2  0
 23 20  1  0
  2 20  1  0
 24 25  2  0
 25 26  1  0
 26 29  2  0
 28 27  2  0
 27 24  1  0
  4 24  1  0
 28 29  1  0
 28 33  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 34 35  1  0
 34 39  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4527313

    ---

Associated Targets(non-human)

pol Human immunodeficiency virus type 1 integrase (9041 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 523.63Molecular Weight (Monoisotopic): 523.2359AlogP: 7.16#Rotatable Bonds: 5
Polar Surface Area: 77.88Molecular Species: ACIDHBA: 5HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.57CX Basic pKa: 4.25CX LogP: 6.42CX LogD: 3.86
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.30Np Likeness Score: -0.23

References

1. Wilson TA, Koneru PC, Rebensburg SV, Lindenberger JJ, Kobe MJ, Cockroft NT, Adu-Ampratwum D, Larue RC, Kvaratskhelia M, Fuchs JR..  (2019)  An Isoquinoline Scaffold as a Novel Class of Allosteric HIV-1 Integrase Inhibitors.,  10  (2): [PMID:30783506] [10.1021/acsmedchemlett.8b00633]

Source