The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-tert-butoxy-2-(1,3-di(chroman-6-yl)isoquinolin-4-yl)acetic acid ID: ALA4527313
PubChem CID: 146000649
Max Phase: Preclinical
Molecular Formula: C33H33NO5
Molecular Weight: 523.63
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)OC(C(=O)O)c1c(-c2ccc3c(c2)CCCO3)nc(-c2ccc3c(c2)CCCO3)c2ccccc12
Standard InChI: InChI=1S/C33H33NO5/c1-33(2,3)39-31(32(35)36)28-24-10-4-5-11-25(24)29(22-12-14-26-20(18-22)8-6-16-37-26)34-30(28)23-13-15-27-21(19-23)9-7-17-38-27/h4-5,10-15,18-19,31H,6-9,16-17H2,1-3H3,(H,35,36)
Standard InChI Key: FXHPWCDDCUFQBC-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 44 0 0 0 0 0 0 0 0999 V2000
33.9863 -4.0983 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.9852 -4.9178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4000 -4.0947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6914 -3.6894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4029 -4.9174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6924 -5.3246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6909 -6.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3991 -6.5525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1103 -6.1402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1083 -5.3245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1062 -3.6834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8154 -4.0894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1031 -2.8663 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.8093 -2.4550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8062 -1.6378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5185 -2.8609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5124 -2.0389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8185 -4.9066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.5216 -3.6781 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.2801 -5.3268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5721 -4.9166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8649 -5.3245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2815 -6.1406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6862 -2.8751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3943 -2.4650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3922 -1.6486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9795 -2.4714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9739 -1.6564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6784 -1.2406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6707 -0.4271 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.9600 -0.0232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2555 -0.4390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2617 -1.2586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5773 -6.5510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8631 -6.1388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1531 -6.5489 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.1509 -7.3728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8651 -7.7850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5814 -7.3732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 6 1 0
5 3 1 0
3 4 2 0
4 1 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 5 2 0
3 11 1 0
11 12 1 0
11 13 1 0
13 14 1 0
14 15 1 0
14 16 1 0
14 17 1 0
12 18 2 0
12 19 1 0
20 21 2 0
21 22 1 0
22 35 2 0
34 23 2 0
23 20 1 0
2 20 1 0
24 25 2 0
25 26 1 0
26 29 2 0
28 27 2 0
27 24 1 0
4 24 1 0
28 29 1 0
28 33 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
34 35 1 0
34 39 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 523.63Molecular Weight (Monoisotopic): 523.2359AlogP: 7.16#Rotatable Bonds: 5Polar Surface Area: 77.88Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.57CX Basic pKa: 4.25CX LogP: 6.42CX LogD: 3.86Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.30Np Likeness Score: -0.23
References 1. Wilson TA, Koneru PC, Rebensburg SV, Lindenberger JJ, Kobe MJ, Cockroft NT, Adu-Ampratwum D, Larue RC, Kvaratskhelia M, Fuchs JR.. (2019) An Isoquinoline Scaffold as a Novel Class of Allosteric HIV-1 Integrase Inhibitors., 10 (2): [PMID:30783506 ] [10.1021/acsmedchemlett.8b00633 ]