The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-isopropyl-2-(6-(4-(5-(N-isopropylcarbamimidoyl)-1H-benzo[d]imidazol-2-yl)phenethyl)pyridin-3-yl)-1H-benzo[d]imidazole-5-carboximidamide ID: ALA452741
PubChem CID: 44565217
Max Phase: Preclinical
Molecular Formula: C35H37N9
Molecular Weight: 583.74
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)NC(=N)c1ccc2[nH]c(-c3ccc(CCc4ccc(-c5nc6cc(C(=N)NC(C)C)ccc6[nH]5)cn4)cc3)nc2c1
Standard InChI: InChI=1S/C35H37N9/c1-20(2)39-32(36)24-11-15-28-30(17-24)43-34(41-28)23-8-5-22(6-9-23)7-13-27-14-10-26(19-38-27)35-42-29-16-12-25(18-31(29)44-35)33(37)40-21(3)4/h5-6,8-12,14-21H,7,13H2,1-4H3,(H2,36,39)(H2,37,40)(H,41,43)(H,42,44)
Standard InChI Key: AXYRSXLUHYNDFB-UHFFFAOYSA-N
Molfile:
RDKit 2D
44 49 0 0 0 0 0 0 0 0999 V2000
-0.0190 -7.5740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5039 -8.2414 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5039 -6.9066 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2885 -7.1615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2885 -7.9865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0030 -8.3990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7175 -7.9865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7175 -7.1615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0030 -6.7490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4319 -6.7490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1464 -7.1615 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.4319 -5.9240 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.8609 -6.7490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5754 -7.1615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8609 -5.9240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8060 -7.5740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6920 -7.8760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6920 -8.7010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9775 -9.1135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9775 -7.4635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2631 -7.8760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2631 -8.7010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4784 -8.9559 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9935 -8.2885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4784 -7.6210 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1685 -8.2885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7560 -9.0029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5185 -8.2885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9310 -7.5740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9310 -9.0029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7560 -7.5740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6935 -8.2885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2810 -7.5740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4065 -7.4635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1209 -7.8760 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4065 -6.6385 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1209 -6.2260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1209 -5.4010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8354 -6.6385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4560 -7.5740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0435 -6.8595 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2185 -6.8595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2185 -8.2885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0435 -8.2885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8 10 1 0
4 5 2 0
10 11 1 0
2 5 1 0
22 23 1 0
23 24 1 0
24 25 2 0
25 21 1 0
10 12 2 0
24 26 1 0
26 27 2 0
5 6 1 0
28 29 1 0
11 13 1 0
4 3 1 0
13 14 1 0
6 7 2 0
26 31 1 0
27 30 1 0
30 28 2 0
29 31 2 0
13 15 1 0
28 32 1 0
3 1 2 0
32 33 1 0
7 8 1 0
17 34 1 0
34 35 2 0
17 18 2 0
34 36 1 0
8 9 2 0
36 37 1 0
18 19 1 0
37 38 1 0
19 22 2 0
37 39 1 0
9 4 1 0
33 40 1 0
21 20 2 0
40 41 2 0
20 17 1 0
41 42 1 0
42 16 2 0
21 22 1 0
16 43 1 0
1 2 1 0
43 44 2 0
44 40 1 0
16 1 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 583.74Molecular Weight (Monoisotopic): 583.3172AlogP: 6.60#Rotatable Bonds: 9Polar Surface Area: 142.01Molecular Species: BASEHBA: 5HBD: 6#RO5 Violations: 3HBA (Lipinski): 9HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 10.95CX Basic pKa: 10.63CX LogP: 5.17CX LogD: 1.06Aromatic Rings: 6Heavy Atoms: 44QED Weighted: 0.08Np Likeness Score: -0.59
References 1. Hu L, Kully ML, Boykin DW, Abood N.. (2009) Synthesis and in vitro activity of dicationic bis-benzimidazoles as a new class of anti-MRSA and anti-VRE agents., 19 (5): [PMID:19208475 ] [10.1016/j.bmcl.2009.01.075 ]