2-(Di(pyridin-2-yl)methylene)-N-(4-((dimethylamino)methyl)phenyl)hydrazine-1-carboxamide

ID: ALA4527447

PubChem CID: 155545166

Max Phase: Preclinical

Molecular Formula: C21H22N6O

Molecular Weight: 374.45

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(C)Cc1ccc(NC(=O)NN=C(c2ccccn2)c2ccccn2)cc1

Standard InChI:  InChI=1S/C21H22N6O/c1-27(2)15-16-9-11-17(12-10-16)24-21(28)26-25-20(18-7-3-5-13-22-18)19-8-4-6-14-23-19/h3-14H,15H2,1-2H3,(H2,24,26,28)

Standard InChI Key:  OAFWNCIRIFOXAK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
   14.3985  -25.0646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3973  -25.8842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1054  -26.2931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8150  -25.8837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8122  -25.0610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1036  -24.6558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6907  -24.6562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9831  -25.0650    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.5234  -26.2912    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.2305  -25.8815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9388  -26.2889    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.2292  -25.0643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.6459  -25.8792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.3542  -26.2867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0613  -25.8770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7668  -26.2847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4734  -25.8757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4725  -25.0576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7592  -24.6503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0556  -25.0617    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2753  -24.6565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9833  -25.8822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3555  -27.1039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6471  -27.5126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6480  -28.3290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3569  -28.7373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0663  -28.3232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0619  -27.5082    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  7  8  1  0
  4  9  1  0
  9 10  1  0
 10 11  1  0
 10 12  2  0
 11 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
  8 21  1  0
  8 22  1  0
 14 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4527447

    ---

Associated Targets(Human)

U-937 (7138 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 374.45Molecular Weight (Monoisotopic): 374.1855AlogP: 3.11#Rotatable Bonds: 6
Polar Surface Area: 82.51Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.00CX Basic pKa: 8.71CX LogP: 3.04CX LogD: 1.71
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.51Np Likeness Score: -1.51

References

1. Ma J, Ni X, Gao Y, Huang K, Liu J, Wang Y, Chen R, Wang C..  (2019)  Identification and biological evaluation of novel benzothiazole derivatives bearing a pyridine-semicarbazone moiety as apoptosis inducers via activation of procaspase-3 to caspase-3.,  10  (3): [PMID:31015910] [10.1039/C8MD00624E]

Source