The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3R,5S)-5-((4-(1-(thiophen-3-ylsulfonyl)-1H-indol-5-ylamino)thieno[3,2-d]pyrimidin-6-yl)ethynyl)pyrrolidin-3-yl morpholine-4-carboxylate ID: ALA452768
PubChem CID: 44564704
Max Phase: Preclinical
Molecular Formula: C29H26N6O5S3
Molecular Weight: 634.77
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O[C@H]1CN[C@H](C#Cc2cc3ncnc(Nc4ccc5c(ccn5S(=O)(=O)c5ccsc5)c4)c3s2)C1)N1CCOCC1
Standard InChI: InChI=1S/C29H26N6O5S3/c36-29(34-8-10-39-11-9-34)40-22-14-20(30-16-22)1-3-23-15-25-27(42-23)28(32-18-31-25)33-21-2-4-26-19(13-21)5-7-35(26)43(37,38)24-6-12-41-17-24/h2,4-7,12-13,15,17-18,20,22,30H,8-11,14,16H2,(H,31,32,33)/t20-,22-/m1/s1
Standard InChI Key: HAYQBGMCBFKTMA-IFMALSPDSA-N
Molfile:
RDKit 2D
43 49 0 0 0 0 0 0 0 0999 V2000
-0.1713 -2.9046 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8858 -2.4921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8858 -1.6671 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1713 -1.2546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5431 -2.4921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5431 -1.6671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3278 -1.4121 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.8127 -2.0796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3278 -2.7470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1713 -0.4296 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6377 -2.0796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4627 -2.0796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2877 -2.0796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7726 -1.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5572 -1.6671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5572 -2.4921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7726 -2.7470 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2247 -1.1822 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9783 -1.5177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6458 -1.0328 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0646 -2.3382 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5595 -0.2123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2270 0.2726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9807 -0.0629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0669 -0.8834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3995 -1.3683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8858 -0.0171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6003 -0.4296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6003 1.2204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8858 0.8079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3147 0.8079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3147 -0.0171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0994 -0.2720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5843 0.3954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0994 1.0629 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.3543 1.8475 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.5697 2.1024 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.1389 1.5925 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6092 2.6321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3939 2.8870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3939 3.7120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6092 3.9670 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.1243 3.2995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 6 1 0
19 21 2 0
20 22 1 0
4 10 1 0
5 6 2 0
8 11 1 0
1 2 2 0
11 12 3 0
20 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
5 1 1 0
10 27 1 0
13 12 1 6
27 28 2 0
28 32 1 0
13 14 1 0
31 29 1 0
2 3 1 0
29 30 2 0
30 27 1 0
31 32 2 0
3 4 2 0
6 7 1 0
14 15 1 0
15 16 1 0
32 33 1 0
33 34 2 0
34 35 1 0
35 31 1 0
16 17 1 0
35 36 1 0
17 13 1 0
36 37 2 0
7 8 1 0
36 38 2 0
39 40 1 0
15 18 1 1
8 9 2 0
18 19 1 0
9 5 1 0
20 19 1 0
40 41 2 0
41 42 1 0
42 43 1 0
43 39 2 0
36 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 634.77Molecular Weight (Monoisotopic): 634.1127AlogP: 4.24#Rotatable Bonds: 5Polar Surface Area: 127.68Molecular Species: NEUTRALHBA: 12HBD: 2#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.25CX LogP: 3.97CX LogD: 3.07Aromatic Rings: 5Heavy Atoms: 43QED Weighted: 0.27Np Likeness Score: -1.24
References 1. Waterson AG, Petrov KG, Hornberger KR, Hubbard RD, Sammond DM, Smith SC, Dickson HD, Caferro TR, Hinkle KW, Stevens KL, Dickerson SH, Rusnak DW, Spehar GM, Wood ER, Griffin RJ, Uehling DE.. (2009) Synthesis and evaluation of aniline headgroups for alkynyl thienopyrimidine dual EGFR/ErbB-2 kinase inhibitors., 19 (5): [PMID:19208477 ] [10.1016/j.bmcl.2009.01.080 ]