(3S,6S,9S,12S,15S,18S,21S,24S,27S)-27-acetamido-18-sec-butyl-3-carbamoyl-24-(carboxymethyl)-12,21-bis((R)-1-hydroxyethyl)-6-isobutyl-9-isopropyl-5,8,11,14,17,20,23,26-octaoxo-15-((2-oxo-7-(phosphonooxy)-2H-chromen-4-yl)methyl)-4,7,10,13,16,19,22,25-octaazanonacosane-1,29-dioic acid

ID: ALA4527772

PubChem CID: 155545287

Max Phase: Preclinical

Molecular Formula: C51H75N10O24P

Molecular Weight: 1243.18

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Bioactivity Summary Target Summary Assay Summary

Names and Identifiers

Canonical SMILES: CC[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(=O)O)NC(C)=O)[C@@H](C)O)C(=O)N[C@@H](Cc1cc(=O)oc2cc(OP(=O)(O)O)ccc12)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(=O)O)C(N)=O)C(C)C)[C@@H](C)O

Standard InChI: InChI=1S/C51H75N10O24P/c1-10-22(6)40(59-51(80)42(24(8)63)61-47(76)33(19-37(69)70)55-45(74)32(18-36(67)68)53-25(9)64)49(78)57-31(14-26-15-38(71)84-34-16-27(11-12-28(26)34)85-86(81,82)83)46(75)60-41(23(7)62)50(79)58-39(21(4)5)48(77)56-30(13-20(2)3)44(73)54-29(43(52)72)17-35(65)66/h11-12,15-16,20-24,29-33,39-42,62-63H,10,13-14,17-19H2,1-9H3,(H2,52,72)(H,53,64)(H,54,73)(H,55,74)(H,56,77)(H,57,78)(H,58,79)(H,59,80)(H,60,75)(H,61,76)(H,65,66)(H,67,68)(H,69,70)(H2,81,82,83)/t22-,23+,24+,29-,30-,31-,32-,33-,39-,40-,41-,42-/m0/s1

Standard InChI Key: QJONLLYTMAZQST-UDOCZINJSA-N

Molfile:

 
     RDKit          2D

 86 87  0  0  0  0  0  0  0  0999 V2000
   42.0358  -14.7548    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.6314  -14.0491    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   41.2224  -14.7522    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.8080  -17.1353    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.8209  -16.3120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2432  -16.3343    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.5385  -15.9135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1204  -15.8913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1332  -15.0722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8466  -14.6737    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.4285  -14.6515    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.5513  -15.0944    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.2688  -14.6960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9566  -15.9358    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.9694  -15.1166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2816  -13.8768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5770  -13.4561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5898  -12.6369    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.8594  -13.8545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.6869  -14.7182    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.3916  -15.1389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1178  -13.9212    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.1050  -14.7404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3788  -15.9580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0793  -16.3787    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.6612  -16.3565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8097  -15.1611    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.5231  -14.7626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2149  -16.0025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.2278  -15.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5359  -13.9434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8353  -13.5228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2534  -13.5450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2663  -12.7259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9453  -14.7849    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.6459  -15.2055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3377  -16.4454    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.6330  -16.0247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3634  -14.8071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9196  -16.4232    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.9067  -17.2465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3248  -17.2687    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.6073  -17.6671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5945  -18.4863    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.2992  -18.9070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0295  -17.6894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.0167  -18.5085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2863  -19.7261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9910  -20.1469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5688  -20.1246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7172  -18.9292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.4348  -18.5308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1266  -19.7706    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.1395  -18.9515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4476  -17.7116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1651  -17.3132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8657  -17.7338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1780  -16.4899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8529  -18.5530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.5575  -18.9737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8272  -20.1913    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.5447  -19.7928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2751  -18.5753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9756  -18.9959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9628  -19.8151    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.6932  -18.5975    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.2494  -20.2136    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.0946  -17.5338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3900  -17.1131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0818  -18.3529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.7558  -16.4676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4733  -16.0692    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.7815  -14.8293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4862  -15.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2037  -14.8516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2165  -14.0324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5118  -13.6117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7943  -14.0101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9299  -13.6339    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.7429  -17.2909    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.0548  -16.0476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0680  -15.2305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3452  -13.6540    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.1924  -17.6434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4915  -17.2232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1790  -18.4605    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  7 12  1  0
 15 20  1  0
 23 27  1  0
 30 35  1  0
 38 40  1  0
 43 44  1  0
 47 51  1  0
 54 59  1  0
 62 67  1  0
  5  4  1  1
  5  7  1  0
  7  6  2  0
  5  8  1  0
  8  9  1  0
  9 10  2  0
  9 11  1  0
 13 12  1  1
 13 15  1  0
 15 14  2  0
 13 16  1  0
 16 17  1  0
 17 18  2  0
 17 19  1  0
 21 20  1  6
 21 23  1  0
 23 22  2  0
 21 24  1  0
 24 25  1  6
 24 26  1  0
 28 27  1  1
 28 30  1  0
 30 29  2  0
 28 31  1  0
 31 32  1  1
 31 33  1  0
 33 34  1  0
 35 36  1  0
 36 38  1  0
 38 37  2  0
 36 39  1  1
 41 40  1  6
 41 43  1  0
 43 42  2  0
 45 44  1  6
 45 47  1  0
 47 46  2  0
 45 48  1  0
 48 49  1  0
 48 50  1  0
 52 51  1  1
 52 54  1  0
 54 53  2  0
 52 55  1  0
 55 56  1  0
 56 57  1  0
 56 58  1  0
 60 59  1  0
 60 62  1  0
 62 61  2  0
 60 63  1  1
 63 64  1  0
 64 65  2  0
 64 66  1  0
  4 68  1  0
 68 69  1  0
 68 70  2  0
 39 82  1  0
 82 73  1  0
 71 72  1  0
 72 74  1  0
 73 74  2  0
 74 75  1  0
 75 76  2  0
 76 77  1  0
 77 78  2  0
 78 73  1  0
 76 79  1  0
 71 80  2  0
 71 81  1  0
 81 82  2  0
 79  2  1  0
  2 83  2  0
 41 84  1  0
 84 85  1  0
 84 86  1  6
M  END

Associated Targets(Human)

PTPN11 Tchem Protein-tyrosine phosphatase 2C (2297 Activities)

Discover Target: PTPN11

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

PTPRM Tchem Receptor-type tyrosine-protein phosphatase mu (41 Activities)

Discover Target: PTPRM

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

Natural Product: No	Oral: No	Chemical Probe: No	Parenteral: No
Molecule Type: Unknown	Topical: No	First In Class: No	Black Box: No
Chirality: No	Availability: No	Prodrug: No

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 1243.18	Molecular Weight (Monoisotopic): 1242.4693	AlogP: ┄	#Rotatable Bonds: ┄
Polar Surface Area: ┄	Molecular Species: ┄	HBA: ┄	HBD: ┄
#RO5 Violations: ┄	HBA (Lipinski): ┄	HBD (Lipinski): ┄	#RO5 Violations (Lipinski): ┄
CX Acidic pKa: ┄	CX Basic pKa: ┄	CX LogP: ┄	CX LogD: ┄
Aromatic Rings: ┄	Heavy Atoms: ┄	QED Weighted: ┄	Np Likeness Score: ┄

References

1. Ma ES, Barrios AM.. (2019) Rational design of a SHP-2 targeted, fluorogenic peptide substrate., 29 (17): [PMID:31351693] [10.1016/j.bmcl.2019.07.034]
2. Lawrence, Harshani R and 10 more authors. 2008-08-28 Inhibitors of Src homology-2 domain containing protein tyrosine phosphatase-2 (Shp2) based on oxindole scaffolds. [PMID:18680359]
3. Geronikaki, A A and 5 more authors. 2008-09-11 2-Thiazolylimino/heteroarylimino-5-arylidene-4-thiazolidinones as new agents with SHP-2 inhibitory action. [PMID:18702480]
4. Dawson, Marcia I MI and 21 more authors. 2008-09-25 Adamantyl-substituted retinoid-derived molecules that interact with the orphan nuclear receptor small heterodimer partner: effects of replacing the 1-adamantyl or hydroxyl group on inhibition of cancer cell growth, induction of cancer cell apoptosis, and inhibition of SRC homology 2 domain-containing protein tyrosine phosphatase-2 activity. [PMID:18759424]
5. He, Yantao and 6 more authors. 2013-02-14 Discovery and evaluation of novel inhibitors of mycobacterium protein tyrosine phosphatase B from the 6-Hydroxy-benzofuran-5-carboxylic acid scaffold. [PMID:23305444]
6. He, Yantao Y and 11 more authors. 2013-06-27 A potent and selective small-molecule inhibitor for the lymphoid-specific tyrosine phosphatase (LYP), a target associated with autoimmune diseases. [PMID:23713581]
7. Zeng, Li-Fan LF and 12 more authors. 2014-08-14 Therapeutic potential of targeting the oncogenic SHP2 phosphatase. [PMID:25003231]
8. Tautz, Lutz L, Senis, Yotis A YA, Oury, Cécile C and Rahmouni, Souad S. 2015-06-15 Perspective: Tyrosine phosphatases as novel targets for antiplatelet therapy. [PMID:25921264]
9. Sun, Wenlong W and 6 more authors. 2017-08-01 Varic acid analogues from fungus as PTP1B inhibitors: Biological evaluation and structure-activity relationships. [PMID:28642102]
10. Xie, Jingjing J and 10 more authors. 2017-12-28 Allosteric Inhibitors of SHP2 with Therapeutic Potential for Cancer Treatment. [PMID:29155585]
11. Du, Yongli Y, Zhang, Yanhui Y, Ling, Hao H, Li, Qunyi Q and Shen, Jingkang J. 2018-01-20 Discovery of novel high potent and cellular active ADC type PTP1B inhibitors with selectivity over TC-PTP via modification interacting with C site. [PMID:29289892]
12. Kim, Bohee and 6 more authors. 2020-01-01 Development and structure-activity relationship study of SHP2 inhibitor containing 3,4,6-trihydroxy-5-oxo-5H-benzo[7]annulene. [PMID:31784318]
13. Wang, Mingliang; Lu, Jianfeng; Wang, Mi; Yang, Chao-Yie and Wang, Shaomeng. 2020-07-23 Discovery of SHP2-D26 as a First, Potent, and Effective PROTAC Degrader of SHP2 Protein. [PMID:32437146]
14. Yuan, Xinrui; Bu, Hong; Zhou, Jinpei; Yang, Chao-Yie and Zhang, Huibin. 2020-10-22 Recent Advances of SHP2 Inhibitors in Cancer Therapy: Current Development and Clinical Application. [PMID:32460492]

(3S,6S,9S,12S,15S,18S,21S,24S,27S)-27-acetamido-18-sec-butyl-3-carbamoyl-24-(carboxymethyl)-12,21-bis((R)-1-hydroxyethyl)-6-isobutyl-9-isopropyl-5,8,11,14,17,20,23,26-octaoxo-15-((2-oxo-7-(phosphonooxy)-2H-chromen-4-yl)methyl)-4,7,10,13,16,19,22,25-octaazanonacosane-1,29-dioic acid

Names and Identifiers

Alternative Forms

Associated Targets(Human)

Molecule Features

Drug Indications

Mechanisms of Action

Calculated Properties

References

Source