5-Allyl-1-(4-allyl-2-methoxyphenoxy)-2-butoxy-3-methoxybenzene

ID: ALA4527823

PubChem CID: 155544584

Max Phase: Preclinical

Molecular Formula: C24H30O4

Molecular Weight: 382.50

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=CCc1ccc(Oc2cc(CC=C)cc(OC)c2OCCCC)c(OC)c1

Standard InChI:  InChI=1S/C24H30O4/c1-6-9-14-27-24-22(26-5)16-19(11-8-3)17-23(24)28-20-13-12-18(10-7-2)15-21(20)25-4/h7-8,12-13,15-17H,2-3,6,9-11,14H2,1,4-5H3

Standard InChI Key:  MGEVYXUYSNLFOQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 29  0  0  0  0  0  0  0  0999 V2000
   14.4191  -13.0709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4180  -13.8904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1260  -14.2994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8357  -13.8900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8329  -13.0673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1242  -12.6620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5390  -12.6560    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2483  -13.0620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2480  -13.8768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9564  -14.2827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6636  -13.8714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6578  -13.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9489  -12.6478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9415  -11.8306    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.6456  -11.4157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1218  -11.8448    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.7113  -12.6625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.7111  -11.8453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1258  -15.1166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4180  -15.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7104  -15.1162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3733  -14.2763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3775  -15.0935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6719  -15.5057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8283  -11.4341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8258  -10.6170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5323  -10.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5299   -9.3891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
 13 14  1  0
 14 15  1  0
  6 16  1  0
  1 17  1  0
 17 18  1  0
  3 19  1  0
 19 20  1  0
 20 21  2  0
 11 22  1  0
 22 23  1  0
 23 24  2  0
 16 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4527823

    ---

Associated Targets(Human)

A2058 (690 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

L929 (3802 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Trypanosoma cruzi (99888 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
B16-F10 (4610 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 382.50Molecular Weight (Monoisotopic): 382.2144AlogP: 6.13#Rotatable Bonds: 12
Polar Surface Area: 36.92Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 6.52CX LogD: 6.52
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.33Np Likeness Score: 0.30

References

1. Ferreira DD, Sousa FS, Costa-Silva TA, Reimão JQ, Torrecilhas AC, Johns DM, Sear CE, Honorio KM, Lago JHG, Anderson EA, Tempone AG, Tempone AG..  (2019)  Dehydrodieugenol B derivatives as antiparasitic agents: Synthesis and biological activity against Trypanosoma cruzi.,  176  [PMID:31103897] [10.1016/j.ejmech.2019.05.001]
2. de Sousa FS,Baldim JL,Azevedo RA,Figueiredo CR,Pieper P,Sear CE,Anderson EA,Lago JHG.  (2020)  Structure-activity relationship study of cytotoxic neolignan derivatives using multivariate analysis and computation-aided drug design.,  30  (16): [PMID:32631547] [10.1016/j.bmcl.2020.127349]

Source