The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-{1,1-Dioxido-3-oxobenzo[d]isothiazol-2(3H)-yl}-N-(8-hydroxyquinolin-5-yl)pentanamide ID: ALA4527922
PubChem CID: 155544623
Max Phase: Preclinical
Molecular Formula: C21H19N3O5S
Molecular Weight: 425.47
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCCCN1C(=O)c2ccccc2S1(=O)=O)Nc1ccc(O)c2ncccc12
Standard InChI: InChI=1S/C21H19N3O5S/c25-17-11-10-16(14-7-5-12-22-20(14)17)23-19(26)9-3-4-13-24-21(27)15-6-1-2-8-18(15)30(24,28)29/h1-2,5-8,10-12,25H,3-4,9,13H2,(H,23,26)
Standard InChI Key: SZNNJYLHQXAJDQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
5.0393 -19.7323 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6308 -20.4463 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.4519 -20.4416 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2851 -22.4987 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5688 -22.9067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8532 -22.4976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1411 -22.9056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9956 -22.9096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9878 -23.7285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6933 -24.1435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4075 -23.7330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6973 -22.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4042 -22.9070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1098 -22.5018 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1097 -21.6859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3982 -21.2770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6955 -21.6887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1193 -24.1457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5682 -23.7281 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4295 -22.4965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4302 -21.6752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7187 -21.2619 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9652 -21.5994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4188 -20.9877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8279 -20.2771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4208 -19.5675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6005 -19.5673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1891 -20.2826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6027 -20.9893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7949 -22.4028 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 1 0
6 7 1 0
4 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 13 1 0
12 8 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 12 2 0
11 18 1 0
5 19 2 0
7 20 1 0
20 21 1 0
21 22 1 0
22 2 1 0
2 25 1 0
24 23 1 0
23 22 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
23 30 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 425.47Molecular Weight (Monoisotopic): 425.1045AlogP: 2.89#Rotatable Bonds: 6Polar Surface Area: 116.67Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.80CX Basic pKa: 4.57CX LogP: 2.41CX LogD: 2.39Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.46Np Likeness Score: -1.35
References 1. Chen C, Yang X, Fang H, Hou X.. (2019) Design, synthesis and preliminary bioactivity evaluations of 8-hydroxyquinoline derivatives as matrix metalloproteinase (MMP) inhibitors., 181 [PMID:31415980 ] [10.1016/j.ejmech.2019.111563 ]