The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(difluoromethyl)-N-(6-((5S,6S)-6-hydroxy-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepin-5-yl)biphenyl-3-yl)-1-isopropyl-1H-pyrazole-5-carboxamide ID: ALA4528101
Cas Number: 2375740-98-8
PubChem CID: 129892190
Product Number: C648681, Order Now?
Max Phase: Preclinical
Molecular Formula: C28H29F2N5O2
Molecular Weight: 505.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)n1nc(C(F)F)cc1C(=O)Nc1ccc([C@H]2[C@@H](O)CCCc3cncn32)c(-c2ccccc2)c1
Standard InChI: InChI=1S/C28H29F2N5O2/c1-17(2)35-24(14-23(33-35)27(29)30)28(37)32-19-11-12-21(22(13-19)18-7-4-3-5-8-18)26-25(36)10-6-9-20-15-31-16-34(20)26/h3-5,7-8,11-17,25-27,36H,6,9-10H2,1-2H3,(H,32,37)/t25-,26-/m0/s1
Standard InChI Key: ANNKHJQLDMGQFM-UIOOFZCWSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
5.1425 -18.9578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9579 -18.9589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3648 -18.2544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9574 -17.5483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1389 -17.5512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7357 -18.2562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7296 -16.8482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1373 -16.1387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7267 -15.4330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9086 -15.4357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5029 -16.1499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9158 -16.8526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9187 -18.2602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5603 -17.5237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1271 -18.6771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7613 -17.3458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1257 -17.8610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5684 -18.9935 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7695 -19.1800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7000 -19.9975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4561 -20.3162 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9927 -19.6957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1820 -18.2546 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5908 -17.5470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4079 -17.5472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1823 -16.8392 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8897 -18.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6670 -17.9539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6672 -17.1366 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8900 -16.8840 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6376 -16.1068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1845 -15.4996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8383 -15.9368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3280 -18.4344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2424 -19.2470 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.0746 -18.1022 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.3431 -16.7277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
5 7 1 0
13 18 1 0
13 14 1 0
19 15 1 0
14 16 1 0
15 17 1 0
16 17 1 0
13 6 1 6
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 18 1 0
3 23 1 0
23 24 1 0
24 25 1 0
24 26 2 0
25 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 25 1 0
30 31 1 0
31 32 1 0
31 33 1 0
28 34 1 0
34 35 1 0
34 36 1 0
14 37 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 505.57Molecular Weight (Monoisotopic): 505.2289AlogP: 5.80#Rotatable Bonds: 6Polar Surface Area: 84.97Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 6.83CX LogP: 4.33CX LogD: 4.26Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.35Np Likeness Score: -0.77
References 1. Schauer NJ, Magin RS, Liu X, Doherty LM, Buhrlage SJ.. (2020) Advances in Discovering Deubiquitinating Enzyme (DUB) Inhibitors., 63 (6): [PMID:31682427 ] [10.1021/acs.jmedchem.9b01138 ] 2. Perez, Christian C and 8 more authors. 2017-02-23 Discovery of an Inhibitor of the Proteasome Subunit Rpn11. [PMID:28191850 ]