3-(difluoromethyl)-N-(6-((5S,6S)-6-hydroxy-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepin-5-yl)biphenyl-3-yl)-1-isopropyl-1H-pyrazole-5-carboxamide

ID: ALA4528101

Cas Number: 2375740-98-8

PubChem CID: 129892190

Product Number: C648681, Order Now?

Max Phase: Preclinical

Molecular Formula: C28H29F2N5O2

Molecular Weight: 505.57

Molecule Type: Unknown

In stock!

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)n1nc(C(F)F)cc1C(=O)Nc1ccc([C@H]2[C@@H](O)CCCc3cncn32)c(-c2ccccc2)c1

Standard InChI:  InChI=1S/C28H29F2N5O2/c1-17(2)35-24(14-23(33-35)27(29)30)28(37)32-19-11-12-21(22(13-19)18-7-4-3-5-8-18)26-25(36)10-6-9-20-15-31-16-34(20)26/h3-5,7-8,11-17,25-27,36H,6,9-10H2,1-2H3,(H,32,37)/t25-,26-/m0/s1

Standard InChI Key:  ANNKHJQLDMGQFM-UIOOFZCWSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
    5.1425  -18.9578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9579  -18.9589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3648  -18.2544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9574  -17.5483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1389  -17.5512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7357  -18.2562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7296  -16.8482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1373  -16.1387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7267  -15.4330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9086  -15.4357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5029  -16.1499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9158  -16.8526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9187  -18.2602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5603  -17.5237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1271  -18.6771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7613  -17.3458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1257  -17.8610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5684  -18.9935    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7695  -19.1800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7000  -19.9975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4561  -20.3162    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9927  -19.6957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1820  -18.2546    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5908  -17.5470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4079  -17.5472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1823  -16.8392    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8897  -18.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6670  -17.9539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6672  -17.1366    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8900  -16.8840    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6376  -16.1068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1845  -15.4996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8383  -15.9368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3280  -18.4344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2424  -19.2470    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.0746  -18.1022    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.3431  -16.7277    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  5  7  1  0
 13 18  1  0
 13 14  1  0
 19 15  1  0
 14 16  1  0
 15 17  1  0
 16 17  1  0
 13  6  1  6
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 18  1  0
  3 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  2  0
 25 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 25  1  0
 30 31  1  0
 31 32  1  0
 31 33  1  0
 28 34  1  0
 34 35  1  0
 34 36  1  0
 14 37  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4528101

    CSN5i-3

Associated Targets(Human)

COPS5 Tchem COP9 signalosome complex subunit 5 (35 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 505.57Molecular Weight (Monoisotopic): 505.2289AlogP: 5.80#Rotatable Bonds: 6
Polar Surface Area: 84.97Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 6.83CX LogP: 4.33CX LogD: 4.26
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.35Np Likeness Score: -0.77

References

1. Schauer NJ, Magin RS, Liu X, Doherty LM, Buhrlage SJ..  (2020)  Advances in Discovering Deubiquitinating Enzyme (DUB) Inhibitors.,  63  (6): [PMID:31682427] [10.1021/acs.jmedchem.9b01138]
2. Perez, Christian C and 8 more authors.  2017-02-23  Discovery of an Inhibitor of the Proteasome Subunit Rpn11.  [PMID:28191850]

Source