The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
rac-1-(3-(5-(Hydroxymethyl)-3-(4-phenoxyphenyl)-1H-pyrazol-1-yl)piperidin-1-yl)prop-2-en-1-one ID: ALA4528314
PubChem CID: 141741246
Max Phase: Preclinical
Molecular Formula: C24H25N3O3
Molecular Weight: 403.48
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)N1CCCC(n2nc(-c3ccc(Oc4ccccc4)cc3)cc2CO)C1
Standard InChI: InChI=1S/C24H25N3O3/c1-2-24(29)26-14-6-7-19(16-26)27-20(17-28)15-23(25-27)18-10-12-22(13-11-18)30-21-8-4-3-5-9-21/h2-5,8-13,15,19,28H,1,6-7,14,16-17H2
Standard InChI Key: SXFHODSMTGHVII-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
11.7034 -5.4607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3767 -5.9374 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.0394 -5.4458 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.7745 -4.6618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9505 -4.6747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3828 -6.7633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6710 -7.1824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6781 -8.0038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3953 -8.4123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1071 -7.9932 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1016 -7.1655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2502 -3.9887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0728 -4.0651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5483 -3.3918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2025 -2.6419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3764 -2.5691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9045 -3.2433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6773 -1.9671 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4991 -2.0410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8420 -2.7934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6630 -2.8676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1388 -2.1925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7876 -1.4411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9677 -1.3705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8247 -8.4002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8310 -9.2252 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.5361 -7.9823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2537 -8.3893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9216 -5.7241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3025 -5.1788 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 2 0
6 7 1 0
6 11 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
6 2 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
4 12 1 0
15 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
10 25 1 0
25 26 2 0
25 27 1 0
27 28 2 0
1 29 1 0
29 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 403.48Molecular Weight (Monoisotopic): 403.1896AlogP: 4.18#Rotatable Bonds: 6Polar Surface Area: 67.59Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.26CX LogP: 3.55CX LogD: 3.55Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.63Np Likeness Score: -0.74
References 1. Ran F, Liu Y, Zhang D, Liu M, Zhao G.. (2019) Discovery of novel pyrazole derivatives as potential anticancer agents in MCL., 29 (9): [PMID:30857748 ] [10.1016/j.bmcl.2019.03.005 ]