The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[6-(2-Ethyl-5-fluoro-4-hydroxy-phenyl)-1H-indazol-4-yl]pyridine-2-sulfonamide ID: ALA4528395
PubChem CID: 155545114
Max Phase: Preclinical
Molecular Formula: C20H17FN4O3S
Molecular Weight: 412.45
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCc1cc(O)c(F)cc1-c1cc(NS(=O)(=O)c2ccccn2)c2cn[nH]c2c1
Standard InChI: InChI=1S/C20H17FN4O3S/c1-2-12-9-19(26)16(21)10-14(12)13-7-17-15(11-23-24-17)18(8-13)25-29(27,28)20-5-3-4-6-22-20/h3-11,25-26H,2H2,1H3,(H,23,24)
Standard InChI Key: JQMWMVMZFDEDHI-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
4.4780 -6.2486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2676 -7.0411 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.0591 -6.8271 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5615 -5.8179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2712 -5.4085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2684 -4.5858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5597 -4.1806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9715 -4.1759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6810 -4.5835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3867 -4.1729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3841 -3.3549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6699 -2.9491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9671 -3.3620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8535 -5.4090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8547 -4.5879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0742 -4.3330 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5905 -4.9966 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0722 -5.6615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5613 -6.6351 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0897 -2.9427 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2687 -7.8611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6833 -5.4007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6639 -2.1320 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.3921 -5.8074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5587 -8.2678 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5595 -9.0871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2708 -9.4969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9828 -9.0815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9785 -8.2636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
14 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 15 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 8 2 0
6 8 1 0
14 15 2 0
15 16 1 0
16 17 1 0
17 18 2 0
18 14 1 0
4 19 1 0
19 2 1 0
11 20 1 0
2 21 1 0
9 22 1 0
12 23 1 0
22 24 1 0
21 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 21 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 412.45Molecular Weight (Monoisotopic): 412.1005AlogP: 3.83#Rotatable Bonds: 5Polar Surface Area: 107.97Molecular Species: ACIDHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 5.72CX Basic pKa: 2.02CX LogP: 3.61CX LogD: 2.68Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.46Np Likeness Score: -1.30
References 1. Ritzén A, Sørensen MD, Dack KN, Greve DR, Jerre A, Carnerup MA, Rytved KA, Bagger-Bahnsen J.. (2016) Fragment-Based Discovery of 6-Arylindazole JAK Inhibitors., 7 (6): [PMID:27326341 ] [10.1021/acsmedchemlett.6b00087 ]