The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-[2-(2-chloro-5-methoxy-phenoxy)ethoxy]-5-(5-methylsulfanylpyrimidin-2-yl)-N-(propylsulfamoyl)pyrimidin-4-amine ID: ALA4528516
PubChem CID: 155544917
Max Phase: Preclinical
Molecular Formula: C21H25ClN6O5S2
Molecular Weight: 541.06
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCNS(=O)(=O)Nc1ncnc(OCCOc2cc(OC)ccc2Cl)c1-c1ncc(SC)cn1
Standard InChI: InChI=1S/C21H25ClN6O5S2/c1-4-7-27-35(29,30)28-20-18(19-23-11-15(34-3)12-24-19)21(26-13-25-20)33-9-8-32-17-10-14(31-2)5-6-16(17)22/h5-6,10-13,27H,4,7-9H2,1-3H3,(H,25,26,28)
Standard InChI Key: TYLZGSIGPRVNQJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
11.4778 -12.8150 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8905 -13.5249 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.2990 -12.8126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8974 -15.1593 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8962 -15.9788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6043 -16.3878 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3139 -15.9783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3111 -15.1557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6025 -14.7504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6001 -13.9332 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1846 -13.9374 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0223 -16.3858 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0236 -17.2030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7319 -17.6105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7332 -18.4277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4416 -18.8352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4385 -19.6508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1460 -20.0582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8540 -19.6485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8501 -18.8270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1420 -18.4233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4748 -13.5326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7692 -13.9449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0594 -13.5400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0142 -14.7457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7238 -15.1533 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4295 -14.7428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4268 -13.9247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7126 -13.5190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0099 -13.9319 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1324 -13.5125 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.8422 -13.9175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5557 -18.4148 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2655 -18.8198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7302 -20.0585 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
9 10 1 0
10 2 1 0
2 11 1 0
7 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
11 22 1 0
22 23 1 0
23 24 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
8 25 1 0
28 31 1 0
31 32 1 0
20 33 1 0
33 34 1 0
17 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 541.06Molecular Weight (Monoisotopic): 540.1016AlogP: 3.43#Rotatable Bonds: 13Polar Surface Area: 137.45Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.34CX Basic pKa: 2.56CX LogP: 3.19CX LogD: 2.90Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.24Np Likeness Score: -1.36
References 1. Boss C, Bolli MH, Gatfield J.. (2016) From bosentan (Tracleer®) to macitentan (Opsumit®): The medicinal chemistry perspective., 26 (15): [PMID:27321813 ] [10.1016/j.bmcl.2016.06.014 ]