The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Yangpumicin A ID: ALA4528553
PubChem CID: 155544900
Max Phase: Preclinical
Molecular Formula: C26H17NO7
Molecular Weight: 455.42
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H](O)[C@@]12O[C@]13c1cc(O)c4c(c1N[C@H]2C#C/C=C\C#C[C@H]3O)C(=O)c1c(O)cccc1C4=O
Standard InChI: InChI=1S/C26H17NO7/c1-12(28)25-17-9-4-2-3-5-10-18(31)26(25,34-25)14-11-16(30)20-21(22(14)27-17)24(33)19-13(23(20)32)7-6-8-15(19)29/h2-3,6-8,11-12,17-18,27-31H,1H3/b3-2-/t12-,17+,18-,25+,26+/m1/s1
Standard InChI Key: OBUHDEKWYQCPLP-ZKZHQQDQSA-N
Molfile:
RDKit 2D
34 39 0 0 0 0 0 0 0 0999 V2000
20.9250 -4.3962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9293 -3.5399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1856 -3.9643 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6373 -6.0488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6354 -4.4023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3519 -4.8097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3508 -5.6398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0646 -6.0536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0670 -4.3933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9256 -5.6377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9299 -4.8134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7856 -4.8118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7843 -5.6377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4972 -6.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2164 -5.6373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0671 -3.5717 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0640 -6.8796 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4969 -6.8758 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4957 -4.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2124 -4.8124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2121 -3.1643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4923 -3.5790 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.6377 -3.1690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3514 -3.5874 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.2138 -2.3426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2055 -1.5181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2012 -0.6963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7807 -1.2758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9927 -2.0715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6586 -4.8308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2132 -2.8976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1639 -5.5221 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.6568 -2.3697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6308 -3.5460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 6
1 3 1 6
10 4 1 0
4 7 2 0
6 5 2 0
5 11 1 0
6 7 1 0
6 9 1 0
7 8 1 0
8 13 1 0
12 9 1 0
10 11 2 0
12 13 2 0
13 14 1 0
14 15 2 0
15 20 1 0
19 12 1 0
9 16 2 0
8 17 2 0
14 18 1 0
19 20 2 0
19 22 1 0
1 20 1 0
2 21 1 0
21 22 1 0
2 23 1 0
23 24 1 0
21 25 1 1
25 26 3 0
26 27 1 0
27 28 2 0
28 29 1 0
1 30 1 0
29 31 3 0
31 30 1 0
30 32 1 1
23 33 1 1
5 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 455.42Molecular Weight (Monoisotopic): 455.1005AlogP: 0.95#Rotatable Bonds: 1Polar Surface Area: 139.62Molecular Species: NEUTRALHBA: 8HBD: 5#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.11CX Basic pKa: ┄CX LogP: 3.69CX LogD: 3.61Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.21Np Likeness Score: 2.10
References 1. Wang Z, Wen Z, Liu L, Zhu X, Shen B, Yan X, Duan Y, Huang Y.. (2019) Yangpumicins F and G, Enediyne Congeners from Micromonospora yangpuensis DSM 45577., 82 (9): [PMID:31490685 ] [10.1021/acs.jnatprod.9b00229 ]