4-(4-(4-(3,4,5-trimethoxyphenyl)pyrimidin-2-yl)piperazine-1-carboxamido)phenyl sulfamate

ID: ALA4528566

PubChem CID: 155544938

Max Phase: Preclinical

Molecular Formula: C24H28N6O7S

Molecular Weight: 544.59

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  COc1cc(-c2ccnc(N3CCN(C(=O)Nc4ccc(OS(N)(=O)=O)cc4)CC3)n2)cc(OC)c1OC

Standard InChI:  InChI=1S/C24H28N6O7S/c1-34-20-14-16(15-21(35-2)22(20)36-3)19-8-9-26-23(28-19)29-10-12-30(13-11-29)24(31)27-17-4-6-18(7-5-17)37-38(25,32)33/h4-9,14-15H,10-13H2,1-3H3,(H,27,31)(H2,25,32,33)

Standard InChI Key:  KKMCJFBJMANXHC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   11.8823  -21.1603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.2991  -20.4545    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   11.4774  -20.4459    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4849  -15.9269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4837  -16.7506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1959  -17.1596    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9097  -16.7501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9069  -15.9233    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1941  -15.5139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6199  -17.1568    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6192  -17.9791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3235  -18.3906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0371  -17.9803    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0378  -17.1580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3248  -16.7461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7480  -18.3946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7462  -19.2159    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4607  -17.9834    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1717  -18.3977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1649  -19.2174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8750  -19.6275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5888  -19.2204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5879  -18.3949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8773  -17.9844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3002  -19.6297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.0069  -20.8643    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7735  -17.1589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0617  -16.7480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3500  -17.1554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3489  -17.9776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0654  -18.3907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7742  -17.9769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6387  -16.7459    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6373  -18.3907    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0676  -19.2120    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6397  -15.9246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9294  -17.9784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3569  -19.6226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
 10 11  1  0
 10 15  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
  7 10  1  0
 13 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 22 25  1  0
 25  2  1  0
  2 26  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
  5 27  1  0
 29 33  1  0
 30 34  1  0
 31 35  1  0
 33 36  1  0
 34 37  1  0
 35 38  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4528566

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 544.59

Molecular Weight (Monoisotopic): 544.1740

AlogP: 2.11

#Rotatable Bonds: 8

Polar Surface Area: 158.44

Molecular Species: NEUTRAL

HBA: 10

HBD: 2

#RO5 Violations: 1

HBA (Lipinski): 13

HBD (Lipinski): 3

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 10.75

CX Basic pKa: 3.67

CX LogP: 2.02

CX LogD: 2.02

Aromatic Rings: 3

Heavy Atoms: 38

QED Weighted: 0.43

Np Likeness Score: -1.28

References

1. Moi D, Foster PA, Rimmer LG, Jaffri A, Deplano A, Balboni G, Onnis V, Potter BVL..  (2019)  Synthesis and in vitro evaluation of piperazinyl-ureido sulfamates as steroid sulfatase inhibitors.,  182  [PMID:31422224] [10.1016/j.ejmech.2019.111614]

2. Nocentini A,Moi D,Deplano A,Osman SM,AlOthman ZA,Balboni G,Supuran CT,Onnis V.  (2020)  Sulfonamide/sulfamate switch with a series of piperazinylureido derivatives: Synthesis, kinetic and in silico evaluation as carbonic anhydrase isoforms I, II, IV, and IX inhibitors.,  186  [PMID:31784185] [10.1016/j.ejmech.2019.111896]

Source

Source(1):

• Scientific Literature