The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-(((6-((3-Chlorobenzyl)thio)-4-oxo-4,5-dihydro-1,3,5-triazin-2-yl)thio)methyl)phenyl)propanoic acid ID: ALA4528607
PubChem CID: 155544885
Max Phase: Preclinical
Molecular Formula: C20H18ClN3O3S2
Molecular Weight: 447.97
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C(=O)O)c1ccc(CSc2nc(SCc3cccc(Cl)c3)[nH]c(=O)n2)cc1
Standard InChI: InChI=1S/C20H18ClN3O3S2/c1-12(17(25)26)15-7-5-13(6-8-15)10-28-19-22-18(27)23-20(24-19)29-11-14-3-2-4-16(21)9-14/h2-9,12H,10-11H2,1H3,(H,25,26)(H,22,23,24,27)
Standard InChI Key: QMNBNKLGYMHKDS-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
37.7173 -4.4739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7162 -5.2934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4242 -5.7024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1339 -5.2929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1311 -4.4703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4224 -4.0650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8372 -4.0590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8341 -3.2418 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
40.5403 -2.8306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2447 -3.2393 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.9488 -2.8316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9499 -2.0140 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.2408 -1.6059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5306 -2.0154 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.6565 -3.2402 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
42.6564 -4.0574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2405 -0.7887 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.3642 -4.4660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3620 -5.2839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0689 -5.6924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.7776 -5.2838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.7750 -4.4624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0675 -4.0576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4240 -6.5196 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
45.4858 -5.6915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.4869 -6.5087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.1930 -5.2819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.9012 -5.6896 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
46.1919 -4.4648 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
9 14 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
11 15 1 0
15 16 1 0
13 17 2 0
16 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
3 24 1 0
21 25 1 0
25 26 1 0
25 27 1 0
27 28 1 0
27 29 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 447.97Molecular Weight (Monoisotopic): 447.0478AlogP: 4.59#Rotatable Bonds: 8Polar Surface Area: 95.94Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.97CX Basic pKa: ┄CX LogP: 5.59CX LogD: 1.53Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.49Np Likeness Score: -1.30
References 1. Bergant K, Janežič M, Valjavec K, Sosič I, Pajk S, Štampar M, Žegura B, Gobec S, Filipič M, Perdih A.. (2019) Structure-guided optimization of 4,6-substituted-1,3,5-triazin-2(1H)-ones as catalytic inhibitors of human DNA topoisomerase IIα., 175 [PMID:31096154 ] [10.1016/j.ejmech.2019.04.055 ]