The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[4-[[3-(phenylcarbamoyl)phenyl]carbamoyl]phenyl]-N,N-diethylcarbamate ID: ALA4528633
PubChem CID: 155545014
Max Phase: Preclinical
Molecular Formula: C25H25N3O4
Molecular Weight: 431.49
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)C(=O)Oc1ccc(C(=O)Nc2cccc(C(=O)Nc3ccccc3)c2)cc1
Standard InChI: InChI=1S/C25H25N3O4/c1-3-28(4-2)25(31)32-22-15-13-18(14-16-22)23(29)27-21-12-8-9-19(17-21)24(30)26-20-10-6-5-7-11-20/h5-17H,3-4H2,1-2H3,(H,26,30)(H,27,29)
Standard InChI Key: YECXHJUAGKPGPG-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
29.9790 -9.2754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9778 -10.1027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6927 -10.5157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4092 -10.1022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4063 -9.2717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6909 -8.8626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2630 -10.5147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5488 -10.1016 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.8340 -10.5136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2624 -11.3397 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.1243 -10.5137 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.8382 -10.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5533 -10.5114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8369 -9.2750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.1206 -10.0983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4062 -10.5095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4051 -11.3355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1244 -11.7484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8357 -11.3348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5500 -11.3349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2642 -11.7462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9790 -11.3325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9751 -10.5033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2602 -10.0957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6947 -11.7429 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.4080 -11.3284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1237 -11.7388 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.4057 -10.5034 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.1262 -12.5638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8371 -11.3243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5527 -11.7347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8419 -12.9743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
8 9 1 0
7 10 2 0
4 11 1 0
11 12 1 0
12 13 1 0
12 14 2 0
9 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 9 1 0
13 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 13 1 0
22 25 1 0
25 26 1 0
26 27 1 0
26 28 2 0
27 29 1 0
27 30 1 0
30 31 1 0
29 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 431.49Molecular Weight (Monoisotopic): 431.1845AlogP: 5.03#Rotatable Bonds: 7Polar Surface Area: 87.74Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.59CX LogD: 4.59Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.55Np Likeness Score: -1.15
References 1. Summer SL, Kell SA, Zhu Z, Moore R, Liotta DC, Myers SJ, Koszalka GW, Traynelis SF, Menaldino DS.. (2019) Di-aryl Sulfonamide Motif Adds π-Stacking Bulk in Negative Allosteric Modulators of the NMDA Receptor., 10 (3): [PMID:30891121 ] [10.1021/acsmedchemlett.8b00395 ]