The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((S)-1-(5-((S)-3-aminopyrrolidin-1-yl)-6-methylpyrazolo[1,5-a]pyrimidin-2-yl)propyl)-5-ethyl-N-methyl-2-(methylsulfonamido)benzamide ID: ALA4528752
PubChem CID: 140311614
Max Phase: Preclinical
Molecular Formula: C25H35N7O3S
Molecular Weight: 513.67
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCc1ccc(NS(C)(=O)=O)c(C(=O)N(C)[C@@H](CC)c2cc3nc(N4CC[C@H](N)C4)c(C)cn3n2)c1
Standard InChI: InChI=1S/C25H35N7O3S/c1-6-17-8-9-20(29-36(5,34)35)19(12-17)25(33)30(4)22(7-2)21-13-23-27-24(16(3)14-32(23)28-21)31-11-10-18(26)15-31/h8-9,12-14,18,22,29H,6-7,10-11,15,26H2,1-5H3/t18-,22-/m0/s1
Standard InChI Key: WCPOISDLBJIGAF-AVRDEDQJSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
6.5871 -8.9024 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5912 -8.0811 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.8773 -8.4903 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1302 -5.3571 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8396 -4.9527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8396 -4.1314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1302 -3.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4208 -4.9527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4163 -4.1314 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6336 -3.8790 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1527 -4.5469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6409 -5.2094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5518 -5.3617 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6361 -6.1787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4393 -6.3497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8490 -5.6384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3030 -5.0304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7706 -7.1009 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5526 -3.7207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3314 -4.5514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9189 -3.8419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3236 -3.1278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9268 -5.2655 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1055 -5.2701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3393 -5.9751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9346 -6.6892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1606 -5.9706 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1153 -6.6884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7066 -7.4016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1233 -8.1080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9488 -8.1009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3497 -7.3912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8853 -7.4058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4731 -6.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1710 -7.3820 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4128 -8.0760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
9 7 1 0
8 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 8 2 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 13 1 0
5 13 1 0
15 18 1 6
6 19 1 0
11 20 1 0
20 21 1 1
21 22 1 0
20 23 1 0
23 24 1 0
23 25 1 0
25 26 1 0
25 27 2 0
26 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 26 1 0
29 33 1 0
33 34 1 0
32 35 1 0
35 2 1 0
2 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 513.67Molecular Weight (Monoisotopic): 513.2522AlogP: 2.73#Rotatable Bonds: 8Polar Surface Area: 125.93Molecular Species: ZWITTERIONHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 5.58CX Basic pKa: 9.83CX LogP: 1.67CX LogD: 1.66Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.47Np Likeness Score: -1.47
References 1. Cockerill GS, Good JAD, Mathews N.. (2019) State of the Art in Respiratory Syncytial Virus Drug Discovery and Development., 62 (7): [PMID:30411898 ] [10.1021/acs.jmedchem.8b01361 ]