Benwamycin F

ID: ALA4528763

PubChem CID: 155544889

Max Phase: Preclinical

Molecular Formula: C20H26O3

Molecular Weight: 314.43

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCC1=CC(=O)[C@@H](C)[C@@H]([C@@H](C)c2ccc(C)cc2/C=C/CO)O1

Standard InChI:  InChI=1S/C20H26O3/c1-5-17-12-19(22)15(4)20(23-17)14(3)18-9-8-13(2)11-16(18)7-6-10-21/h6-9,11-12,14-15,20-21H,5,10H2,1-4H3/b7-6+/t14-,15+,20+/m0/s1

Standard InChI Key:  WXBORBNFASCHJC-PHJRLBKFSA-N

Molfile:  

 
     RDKit          2D

 24 25  0  0  0  0  0  0  0  0999 V2000
   29.6233   -5.9299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3310   -5.5183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0387   -5.9299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0387   -6.7490    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.3310   -7.1565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6233   -6.7490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3310   -7.9752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6236   -8.3825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7503   -5.5184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7503   -4.7038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4577   -5.9299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1654   -5.5187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8693   -5.9293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8693   -6.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1680   -7.1547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4577   -6.7495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5808   -7.1557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1654   -4.7041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8729   -4.2927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8729   -3.4739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5844   -3.0666    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.0387   -5.1111    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   30.3310   -4.7036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9117   -5.5184    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  3  4  1  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  5  7  1  0
  7  8  1  0
  3  9  1  0
  9 10  1  1
  9 11  1  0
 12 11  2  0
 13 12  1  0
 14 13  2  0
 15 14  1  0
 16 15  2  0
 11 16  1  0
 14 17  1  0
 12 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
  3 22  1  6
  2 23  1  1
  1 24  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4528763

    ---

Associated Targets(non-human)

3T3-L1 (3664 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 314.43Molecular Weight (Monoisotopic): 314.1882AlogP: 4.00#Rotatable Bonds: 5
Polar Surface Area: 46.53Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.26CX LogD: 4.26
Aromatic Rings: 1Heavy Atoms: 23QED Weighted: 0.89Np Likeness Score: 1.32

References

1. Yang FX, Huang JP, Liu Z, Wang Z, Yang J, Tang J, Yu Z, Yan Y, Kai G, Huang SX..  (2020)  Benwamycins A-G, Trialkyl-Substituted Benzene Derivatives from a Soil-Derived Streptomyces.,  83  (1): [PMID:31904958] [10.1021/acs.jnatprod.9b00903]

Source