4-(3-((4-(1-Cyclopentyl-1,2,3,4-tetrahydroisoquinolin-1-yl)piperidin-1-yl)methyl)piperidin-1-yl)benzonitrile

ID: ALA4528850

PubChem CID: 138618502

Max Phase: Preclinical

Molecular Formula: C32H42N4

Molecular Weight: 482.72

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N#Cc1ccc(N2CCCC(CN3CCC(C4(C5CCCC5)NCCc5ccccc54)CC3)C2)cc1

Standard InChI:  InChI=1S/C32H42N4/c33-22-25-11-13-30(14-12-25)36-19-5-6-26(24-36)23-35-20-16-29(17-21-35)32(28-8-2-3-9-28)31-10-4-1-7-27(31)15-18-34-32/h1,4,7,10-14,26,28-29,34H,2-3,5-6,8-9,15-21,23-24H2

Standard InChI Key:  DRMSIRORFBINAW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 41  0  0  0  0  0  0  0  0999 V2000
   39.1999  -12.2957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1988  -13.1222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9129  -13.5346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6286  -13.1217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9111  -11.8833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6249  -12.2925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.3322  -11.8813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.3320  -11.0591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6182  -10.6500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.9047  -11.0629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4845  -10.3436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8194   -9.5808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1974   -9.0266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4780   -9.4468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6555  -10.2607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1015  -11.2717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5198  -10.6785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7196  -10.8845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4946  -11.6838    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.0765  -12.2770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8831  -12.0710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6915  -11.8920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1135  -11.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3351  -10.5136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7611   -9.9273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9619  -10.1300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7399  -10.9247    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.3171  -11.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9414  -11.1287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3695  -10.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5717  -10.7410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3484  -11.5352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9293  -12.1259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7249  -11.9194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5545  -11.7420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7562  -11.9471    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  1  1  0
  5  6  2  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 10 16  1  0
 16 17  1  0
 16 21  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 19 22  1  0
 22 23  1  0
 23 24  1  0
 23 28  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 35 36  3  0
 32 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4528850

    ---

Associated Targets(Human)

MEN1 Tchem Menin (447 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MV4-11 (7307 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 482.72Molecular Weight (Monoisotopic): 482.3409AlogP: 5.72#Rotatable Bonds: 5
Polar Surface Area: 42.30Molecular Species: BASEHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 10.22CX LogP: 5.99CX LogD: 1.43
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.59Np Likeness Score: -0.73

References

1. Aguilar A, Zheng K, Xu T, Xu S, Huang L, Fernandez-Salas E, Liu L, Bernard D, Harvey KP, Foster C, McEachern D, Stuckey J, Chinnaswamy K, Delproposto J, Kampf JW, Wang S..  (2019)  Structure-Based Discovery of M-89 as a Highly Potent Inhibitor of the Menin-Mixed Lineage Leukemia (Menin-MLL) Protein-Protein Interaction.,  62  (13): [PMID:31244110] [10.1021/acs.jmedchem.9b00021]

Source