The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(3-((4-(1-Cyclopentyl-1,2,3,4-tetrahydroisoquinolin-1-yl)piperidin-1-yl)methyl)piperidin-1-yl)benzonitrile ID: ALA4528850
PubChem CID: 138618502
Max Phase: Preclinical
Molecular Formula: C32H42N4
Molecular Weight: 482.72
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1ccc(N2CCCC(CN3CCC(C4(C5CCCC5)NCCc5ccccc54)CC3)C2)cc1
Standard InChI: InChI=1S/C32H42N4/c33-22-25-11-13-30(14-12-25)36-19-5-6-26(24-36)23-35-20-16-29(17-21-35)32(28-8-2-3-9-28)31-10-4-1-7-27(31)15-18-34-32/h1,4,7,10-14,26,28-29,34H,2-3,5-6,8-9,15-21,23-24H2
Standard InChI Key: DRMSIRORFBINAW-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 41 0 0 0 0 0 0 0 0999 V2000
39.1999 -12.2957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1988 -13.1222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9129 -13.5346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6286 -13.1217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9111 -11.8833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6249 -12.2925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3322 -11.8813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3320 -11.0591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6182 -10.6500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.9047 -11.0629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4845 -10.3436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8194 -9.5808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1974 -9.0266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4780 -9.4468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6555 -10.2607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1015 -11.2717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5198 -10.6785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7196 -10.8845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4946 -11.6838 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.0765 -12.2770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8831 -12.0710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6915 -11.8920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1135 -11.3044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3351 -10.5136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7611 -9.9273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9619 -10.1300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7399 -10.9247 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.3171 -11.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9414 -11.1287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3695 -10.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5717 -10.7410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3484 -11.5352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9293 -12.1259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7249 -11.9194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5545 -11.7420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7562 -11.9471 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 1 1 0
5 6 2 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 11 1 0
10 16 1 0
16 17 1 0
16 21 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
19 22 1 0
22 23 1 0
23 24 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
27 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
35 36 3 0
32 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 482.72Molecular Weight (Monoisotopic): 482.3409AlogP: 5.72#Rotatable Bonds: 5Polar Surface Area: 42.30Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 10.22CX LogP: 5.99CX LogD: 1.43Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.59Np Likeness Score: -0.73
References 1. Aguilar A, Zheng K, Xu T, Xu S, Huang L, Fernandez-Salas E, Liu L, Bernard D, Harvey KP, Foster C, McEachern D, Stuckey J, Chinnaswamy K, Delproposto J, Kampf JW, Wang S.. (2019) Structure-Based Discovery of M-89 as a Highly Potent Inhibitor of the Menin-Mixed Lineage Leukemia (Menin-MLL) Protein-Protein Interaction., 62 (13): [PMID:31244110 ] [10.1021/acs.jmedchem.9b00021 ]