5,7-difluoro-2-methyl-3-undecyl-1H-quinolin-4-one

ID: ALA4529042

PubChem CID: 67016340

Max Phase: Preclinical

Molecular Formula: C21H29F2NO

Molecular Weight: 349.47

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCCc1c(C)[nH]c2cc(F)cc(F)c2c1=O

Standard InChI:  InChI=1S/C21H29F2NO/c1-3-4-5-6-7-8-9-10-11-12-17-15(2)24-19-14-16(22)13-18(23)20(19)21(17)25/h13-14H,3-12H2,1-2H3,(H,24,25)

Standard InChI Key:  KEQGBWOWJDYGAQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 26  0  0  0  0  0  0  0  0999 V2000
   32.6898   -4.4730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3975   -4.0613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1053   -4.4730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1053   -5.2879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3975   -5.6996    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.6898   -5.2879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9806   -5.6971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2725   -5.2898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2699   -4.4724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9776   -4.0592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9776   -3.2404    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   30.5650   -5.6971    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   34.8127   -5.6994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8127   -4.0615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5243   -4.4730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2317   -4.0615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9392   -4.4730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6507   -4.0615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3582   -4.4730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0656   -4.0615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7730   -4.4730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4846   -4.0615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1920   -4.4730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8995   -4.0615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3975   -3.2426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  1  0
  1  6  2  0
  6  7  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
  1 10  1  0
 10 11  1  0
  8 12  1  0
  4 13  1  0
  3 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
  2 25  2  0
M  END

Alternative Forms

Associated Targets(non-human)

Toxoplasma gondii (4585 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Plasmodium falciparum (966862 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 349.47Molecular Weight (Monoisotopic): 349.2217AlogP: 6.19#Rotatable Bonds: 10
Polar Surface Area: 32.86Molecular Species: NEUTRALHBA: 1HBD: 1
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 7.28CX LogD: 7.28
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.51Np Likeness Score: -0.31

References

1. Deng Y, Wu T, Zhai SQ, Li CH..  (2019)  Recent progress on anti-Toxoplasma drugs discovery: Design, synthesis and screening.,  183  [PMID:31585276] [10.1016/j.ejmech.2019.111711]
2. Wu RZ, Zhou HY, Song JF, Xia QH, Hu W, Mou XD, Li X..  (2021)  Chemotherapeutics for Toxoplasma gondii: Molecular Biotargets, Binding Modes, and Structure-Activity Relationship Investigations.,  64  (24.0): [PMID:34894691] [10.1021/acs.jmedchem.1c01569]

Source