The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1Z,4R,5E,8S,9S)-5-Methyl-11-oxo-8-(1-methylethenyl)-10-oxabicyclo[7.2.1]dodeca-1(12),5-dien-4-yl 4-Nitrobenzoate ID: ALA4529216
PubChem CID: 155545169
Max Phase: Preclinical
Molecular Formula: C22H23NO6
Molecular Weight: 397.43
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=C(C)[C@@H]1C/C=C(\C)[C@H](OC(=O)c2ccc([N+](=O)[O-])cc2)CCC2=C[C@@H]1OC2=O
Standard InChI: InChI=1S/C22H23NO6/c1-13(2)18-10-4-14(3)19(11-7-16-12-20(18)29-22(16)25)28-21(24)15-5-8-17(9-6-15)23(26)27/h4-6,8-9,12,18-20H,1,7,10-11H2,2-3H3/b14-4+/t18-,19+,20-/m0/s1
Standard InChI Key: AXWUAGBXSRZAOF-ZAIWJUQASA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
31.4104 -8.3367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2235 -8.3367 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.4768 -7.5602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8149 -7.0815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1594 -7.5602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3749 -6.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3749 -7.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0761 -5.9268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7816 -6.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1853 -7.1596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1906 -6.3466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4832 -5.9341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9290 -8.9949 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.0761 -5.1137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.8868 -7.5701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8839 -8.3831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5952 -7.1676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0549 -8.1374 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
32.3551 -6.9158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7839 -4.7051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7839 -3.8879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4916 -5.1137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.4974 -3.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4978 -2.6627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7895 -2.2533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0795 -2.6663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0826 -3.4814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7879 -1.4360 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.0796 -1.0283 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.4950 -1.0264 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 2 0
5 1 1 0
6 7 1 0
6 8 1 0
7 5 1 0
9 8 1 0
9 12 2 0
3 10 1 0
10 11 1 0
11 12 1 0
1 13 2 0
8 14 1 1
10 15 1 1
15 16 2 0
15 17 1 0
3 18 1 6
9 19 1 0
14 20 1 0
20 21 1 0
20 22 2 0
21 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 21 1 0
28 29 2 0
28 30 1 0
25 28 1 0
M CHG 2 28 1 30 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 397.43Molecular Weight (Monoisotopic): 397.1525AlogP: 4.29#Rotatable Bonds: 4Polar Surface Area: 95.74Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.61CX Basic pKa: ┄CX LogP: 5.02CX LogD: 5.02Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.33Np Likeness Score: 1.48
References 1. Lou LL, Ni FQ, Chen L, Shaker S, Li W, Wang R, Tang GH, Yin S.. (2019) Germacrane Sesquiterpenoids as a New Type of Anticardiac Fibrosis Agent Targeting Transforming Growth Factor β Type I Receptor., 62 (17): [PMID:31408333 ] [10.1021/acs.jmedchem.9b00708 ]