The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[6-(2-Ethyl-5-fluoro-4-hydroxy-phenyl)-1H-indazol-4-yl]-2-(1-piperidyl)ethanesulfonamide ID: ALA4529314
PubChem CID: 155545338
Max Phase: Preclinical
Molecular Formula: C22H27FN4O3S
Molecular Weight: 446.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCc1cc(O)c(F)cc1-c1cc(NS(=O)(=O)CCN2CCCCC2)c2cn[nH]c2c1
Standard InChI: InChI=1S/C22H27FN4O3S/c1-2-15-12-22(28)19(23)13-17(15)16-10-20-18(14-24-25-20)21(11-16)26-31(29,30)9-8-27-6-4-3-5-7-27/h10-14,26,28H,2-9H2,1H3,(H,24,25)
Standard InChI Key: CDWPEMMGCKFZHG-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
31.7054 -2.9097 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.4949 -3.7021 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
32.2864 -3.4882 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.7889 -2.4790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4985 -2.0696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4957 -1.2469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7871 -0.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1988 -0.8369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9084 -1.2446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6140 -0.8340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6114 -0.0159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8972 0.3944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1944 -0.0231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0808 -2.0700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0820 -1.2490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3015 -0.9941 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.8179 -1.6576 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.2995 -2.3225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7887 -3.2962 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.3170 0.4044 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.4961 -4.5222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9106 -2.0618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8912 1.2116 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
33.6194 -2.4684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2044 -4.9297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2055 -5.7469 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.4979 -6.1536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4971 -6.9672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2036 -7.3786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9126 -6.9702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9150 -6.1504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
14 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 15 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 8 2 0
6 8 1 0
14 15 2 0
15 16 1 0
16 17 1 0
17 18 2 0
18 14 1 0
4 19 1 0
19 2 1 0
11 20 1 0
2 21 1 0
9 22 1 0
12 23 1 0
22 24 1 0
21 25 1 0
25 26 1 0
26 27 1 0
26 31 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.55Molecular Weight (Monoisotopic): 446.1788AlogP: 3.86#Rotatable Bonds: 7Polar Surface Area: 98.32Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.06CX Basic pKa: 7.82CX LogP: 2.24CX LogD: 2.36Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.51Np Likeness Score: -1.35
References 1. Ritzén A, Sørensen MD, Dack KN, Greve DR, Jerre A, Carnerup MA, Rytved KA, Bagger-Bahnsen J.. (2016) Fragment-Based Discovery of 6-Arylindazole JAK Inhibitors., 7 (6): [PMID:27326341 ] [10.1021/acsmedchemlett.6b00087 ]