6-(2,6-dichlorophenyl)-8-(hydroxymethyl)-2-(2'-methyl-2',3'-dihydro-1'H-spiro[cyclopropane-1,4'-isoquinoline]-7'-ylamino)pyrido[4,3-d]pyrimidin-5(6H)-one

ID: ALA4529353

PubChem CID: 71724574

Max Phase: Preclinical

Molecular Formula: C26H23Cl2N5O2

Molecular Weight: 508.41

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN1Cc2cc(Nc3ncc4c(=O)n(-c5c(Cl)cccc5Cl)cc(CO)c4n3)ccc2C2(CC2)C1

Standard InChI:  InChI=1S/C26H23Cl2N5O2/c1-32-11-15-9-17(5-6-19(15)26(14-32)7-8-26)30-25-29-10-18-22(31-25)16(13-34)12-33(24(18)35)23-20(27)3-2-4-21(23)28/h2-6,9-10,12,34H,7-8,11,13-14H2,1H3,(H,29,30,31)

Standard InChI Key:  ICNHYRCGEFUMGJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 40  0  0  0  0  0  0  0  0999 V2000
    4.3749  -26.7940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7876  -27.5039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1960  -26.7915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1950  -29.1351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9013  -28.7282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8990  -27.9097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1942  -27.5061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6094  -29.1360    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3167  -28.7267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0232  -29.1372    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0165  -27.5028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3126  -27.9138    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7296  -27.9105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7277  -28.7297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1451  -27.9139    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4361  -27.5003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1721  -28.7330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4329  -29.1337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4368  -26.6832    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8469  -27.4952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5559  -27.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2572  -27.4783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2460  -26.6604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5275  -26.2621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8291  -26.6824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1134  -26.2881    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   12.5651  -28.7135    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    5.4908  -28.7278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4913  -27.9124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0824  -27.9115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0818  -28.7269    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7883  -29.1373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3734  -29.1343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4233  -29.9508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7108  -30.3511    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  1  3  1  0
 28  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7 29  1  0
  5  8  1  0
  8  9  1  0
  9 10  2  0
 10 14  1  0
 13 11  1  0
 11 12  2  0
 12  9  1  0
 13 14  2  0
 13 16  1  0
 14 18  1  0
 17 15  1  0
 15 16  1  0
 17 18  2  0
 16 19  2  0
 15 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 25 26  1  0
 21 27  1  0
 28 29  2  0
 28 32  1  0
 29  2  1  0
  2 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  1  0
 18 34  1  0
 34 35  1  0
M  END

Associated Targets(Human)

WEE1 Tchem Serine/threonine-protein kinase WEE1 (1772 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NCI-H1299 (3248 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 508.41Molecular Weight (Monoisotopic): 507.1229AlogP: 4.80#Rotatable Bonds: 4
Polar Surface Area: 83.28Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.53CX Basic pKa: 8.17CX LogP: 4.27CX LogD: 3.44
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.41Np Likeness Score: -0.57

References

1. Mastracchio A, Lai C, Torrent M, Bromberg K, Buchanan FG, Ferguson D, Bontcheva V, Johnson EF, Lasko L, Maag D, Shoemaker AR, Penning TD..  (2019)  Investigation of biaryl heterocycles as inhibitors of Wee1 kinase.,  29  (12): [PMID:31014911] [10.1016/j.bmcl.2019.04.017]

Source