The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(Difluoromethyl)-4-methoxy-1-[4-(4-morpholinyl)-6-(4-[[2-(2-pyridinyl)ethyl]sulfonyl]-1-piperazinyl)-1,3,5-triazin-2-yl]-1H-benzimidazole ID: ALA4529406
PubChem CID: 46917284
Max Phase: Preclinical
Molecular Formula: C27H31F2N9O4S
Molecular Weight: 615.67
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc2c1nc(C(F)F)n2-c1nc(N2CCOCC2)nc(N2CCN(S(=O)(=O)CCc3ccccn3)CC2)n1
Standard InChI: InChI=1S/C27H31F2N9O4S/c1-41-21-7-4-6-20-22(21)31-24(23(28)29)38(20)27-33-25(32-26(34-27)36-14-16-42-17-15-36)35-10-12-37(13-11-35)43(39,40)18-8-19-5-2-3-9-30-19/h2-7,9,23H,8,10-18H2,1H3
Standard InChI Key: CPEFDLBJXMQXQR-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 48 0 0 0 0 0 0 0 0999 V2000
31.0739 -26.4266 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.6694 -25.7209 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
30.2605 -26.4240 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.4294 -23.2693 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.4282 -24.0888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1363 -24.4978 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.8459 -24.0883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8431 -23.2657 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.1345 -22.8604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7202 -24.4968 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.0165 -24.0832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3106 -24.4878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3057 -25.3053 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.0129 -25.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7250 -25.3105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1320 -22.0432 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.7850 -21.5602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5310 -20.7835 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.4637 -21.5639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7136 -20.7891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1680 -20.1874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3725 -20.3592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1254 -21.1382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6726 -21.7366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4815 -21.9876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4596 -22.8045 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
29.1999 -21.5981 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
26.4179 -19.4094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.2167 -19.2368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5543 -24.4958 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.5513 -25.3132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2556 -25.7206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9650 -25.3143 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.9657 -24.4962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2569 -24.0843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3805 -25.3175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0851 -25.7314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7958 -25.3281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4966 -25.7440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2068 -25.3414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2134 -24.5233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5038 -24.1096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7965 -24.5145 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
5 10 1 0
10 11 1 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
9 16 1 0
16 17 1 0
17 18 2 0
18 20 1 0
19 16 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
17 25 1 0
25 26 1 0
25 27 1 0
21 28 1 0
28 29 1 0
7 30 1 0
30 31 1 0
30 35 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
33 2 1 0
2 36 1 0
36 37 1 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 42 1 0
42 43 2 0
43 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 615.67Molecular Weight (Monoisotopic): 615.2188AlogP: 2.08#Rotatable Bonds: 9Polar Surface Area: 131.70Molecular Species: NEUTRALHBA: 12HBD: ┄#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 5.96CX LogP: 2.98CX LogD: 2.97Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.27Np Likeness Score: -1.53
References 1. Giddens AC, Gamage SA, Kendall JD, Lee WJ, Baguley BC, Buchanan CM, Jamieson SMF, Dickson JMJ, Shepherd PR, Denny WA, Rewcastle GW.. (2019) Synthesis and biological evaluation of solubilized sulfonamide analogues of the phosphatidylinositol 3-kinase inhibitor ZSTK474., 27 (8): [PMID:30850264 ] [10.1016/j.bmc.2019.02.050 ]