Brachangobinan I

ID: ALA4529433

PubChem CID: 155545583

Max Phase: Preclinical

Molecular Formula: C23H26O7

Molecular Weight: 414.45

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc([C@@H]2Oc3c(OC)cc(C=O)cc3[C@H]2COC(=O)CC(C)C)ccc1O

Standard InChI:  InChI=1S/C23H26O7/c1-13(2)7-21(26)29-12-17-16-8-14(11-24)9-20(28-4)23(16)30-22(17)15-5-6-18(25)19(10-15)27-3/h5-6,8-11,13,17,22,25H,7,12H2,1-4H3/t17-,22+/m1/s1

Standard InChI Key:  PHOKYTQYMWTTST-VGSWGCGISA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   35.0399  -11.7158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7496  -11.3063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7467  -10.4837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0381  -10.0784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0397  -12.5329    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.3319  -12.9414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4529  -10.0724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3319  -11.3068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3331  -10.4903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5569  -10.2367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0759  -10.8967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5549  -11.5579    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.2620  -10.8979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8551  -10.1879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0386  -10.1864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6282  -10.8941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0402  -11.6047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8552  -11.6027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8110  -10.8940    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.6314   -9.4779    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.8142   -9.4763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3055   -9.4592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8533   -8.8527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.6019   -8.0751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1497   -7.4687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8029   -7.9040    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.9488   -7.6398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4965   -7.0334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2001   -8.4174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4498   -9.2552    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  8  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  9  1  0
  1  5  1  0
  5  6  1  0
  3  7  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12  8  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 11 13  1  1
 16 19  1  0
 15 20  1  0
 20 21  1  0
 10 22  1  6
 22 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  2  0
 25 27  1  0
 27 28  1  0
 27 29  1  0
  7 30  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4529433

    ---

Associated Targets(non-human)

Trypanosoma congolense (178 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 414.45Molecular Weight (Monoisotopic): 414.1679AlogP: 4.03#Rotatable Bonds: 8
Polar Surface Area: 91.29Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.91CX Basic pKa: CX LogP: 3.58CX LogD: 3.58
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.52Np Likeness Score: 1.53

References

1. Odonbayar B, Murata T, Suganuma K, Ishikawa Y, Buyankhishig B, Batkhuu J, Sasaki K..  (2019)  Acylated Lignans Isolated from Brachanthemum gobicum and Their Trypanocidal Activity.,  82  (4): [PMID:30896183] [10.1021/acs.jnatprod.8b00670]

Source