3-[3-[(2R)-3-oxo-2-piperidyl]propyl]quinazolin-4-one

ID: ALA4529460

PubChem CID: 132451788

Max Phase: Preclinical

Molecular Formula: C16H19N3O2

Molecular Weight: 285.35

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1CCCN[C@@H]1CCCn1cnc2ccccc2c1=O

Standard InChI:  InChI=1S/C16H19N3O2/c20-15-8-3-9-17-14(15)7-4-10-19-11-18-13-6-2-1-5-12(13)16(19)21/h1-2,5-6,11,14,17H,3-4,7-10H2/t14-/m1/s1

Standard InChI Key:  QJHHYCHORSWZHW-CQSZACIVSA-N

Molfile:  

 
     RDKit          2D

 21 23  0  0  0  0  0  0  0  0999 V2000
   30.1933   -5.4709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1933   -6.2903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9014   -6.6980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6095   -6.2904    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.6095   -5.4709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9014   -5.0591    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.3217   -6.6980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0297   -6.2904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7378   -6.6980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4459   -6.2904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4459   -5.4709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1581   -5.0592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8661   -5.4710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8661   -6.2904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1581   -6.6980    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.7378   -5.0591    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.9014   -7.5175    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.4811   -6.6979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7730   -6.2903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7730   -5.4708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4811   -5.0590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  1  6  1  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
 10  9  1  6
 11 10  1  0
 12 11  1  0
 13 12  1  0
 14 13  1  0
 15 14  1  0
 10 15  1  0
 11 16  2  0
  3 17  2  0
  2 18  1  0
 19 18  2  0
 20 19  1  0
 21 20  2  0
  1 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4529460

    ---

Associated Targets(non-human)

Toxoplasma gondii (4585 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 285.35Molecular Weight (Monoisotopic): 285.1477AlogP: 1.50#Rotatable Bonds: 4
Polar Surface Area: 63.99Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.42CX LogP: 1.41CX LogD: 1.10
Aromatic Rings: 2Heavy Atoms: 21QED Weighted: 0.92Np Likeness Score: -0.60

References

1. Deng Y, Wu T, Zhai SQ, Li CH..  (2019)  Recent progress on anti-Toxoplasma drugs discovery: Design, synthesis and screening.,  183  [PMID:31585276] [10.1016/j.ejmech.2019.111711]

Source