The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-benzyl-7,7-dimethyl-5-oxo-4-phenyl-5,6,7,8-tetrahydro-1H-pyrrolo[2,3-b]quinoline-3-carbonitrile ID: ALA4529463
PubChem CID: 129907741
Max Phase: Preclinical
Molecular Formula: C27H23N3O
Molecular Weight: 405.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC1(C)CC(=O)c2c(nc3c(c(C#N)cn3Cc3ccccc3)c2-c2ccccc2)C1
Standard InChI: InChI=1S/C27H23N3O/c1-27(2)13-21-25(22(31)14-27)23(19-11-7-4-8-12-19)24-20(15-28)17-30(26(24)29-21)16-18-9-5-3-6-10-18/h3-12,17H,13-14,16H2,1-2H3
Standard InChI Key: QRAZJRNLKMFUIK-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
19.3319 -4.1149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5863 -3.3382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9233 -2.8560 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.5147 -4.1149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2649 -3.3392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4698 -3.1690 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9728 -4.7176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1783 -4.5511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9264 -3.7743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1322 -3.6049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5841 -4.2095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8360 -4.9863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6359 -5.1585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8122 -4.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2917 -5.4367 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9216 -2.0389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2130 -1.6318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2135 -0.8150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5058 -0.4080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7979 -0.8182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8023 -1.6396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5107 -2.0429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8890 -5.9355 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7879 -4.4161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1676 -3.4958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2257 -5.4921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6782 -6.1002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9315 -6.8764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7319 -7.0455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2785 -6.4323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0223 -5.6586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 1 1 0
1 2 2 0
2 3 1 0
3 5 1 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
14 15 3 0
1 14 1 0
3 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
13 23 2 0
11 24 1 0
11 25 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
7 26 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 405.50Molecular Weight (Monoisotopic): 405.1841AlogP: 5.78#Rotatable Bonds: 3Polar Surface Area: 58.68Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 1.58CX LogP: 5.44CX LogD: 5.44Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.43Np Likeness Score: -0.73
References 1. Stanton RA, Lu X, Detorio M, Montero C, Hammond ET, Ehteshami M, Domaoal RA, Nettles JH, Feraud M, Schinazi RF.. (2016) Discovery, characterization, and lead optimization of 7-azaindole non-nucleoside HIV-1 reverse transcriptase inhibitors., 26 (16): [PMID:27390064 ] [10.1016/j.bmcl.2016.06.065 ]