3-(4-chlorophenyl)-1-(6-methylbenzo[d]thiazol-2-yl)indeno[1,2-c]pyrazol-4(1H)-one

ID: ALA4529604

PubChem CID: 139237475

Max Phase: Preclinical

Molecular Formula: C24H14ClN3OS

Molecular Weight: 427.92

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc2nc(-n3nc(-c4ccc(Cl)cc4)c4c3-c3ccccc3C4=O)sc2c1

Standard InChI:  InChI=1S/C24H14ClN3OS/c1-13-6-11-18-19(12-13)30-24(26-18)28-22-16-4-2-3-5-17(16)23(29)20(22)21(27-28)14-7-9-15(25)10-8-14/h2-12H,1H3

Standard InChI Key:  WRUNBCVDVHTHLE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 35  0  0  0  0  0  0  0  0999 V2000
   23.4476   -7.3018    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.0582   -6.7498    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.7197   -6.0025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9052   -6.0865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7344   -6.8891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5708   -5.3351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1855   -4.7914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1855   -3.9701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8946   -3.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6037   -3.9701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6037   -4.7914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8946   -5.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7683   -5.1644    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.4713   -6.3686    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   24.8607   -6.9206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1951   -7.6720    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.0097   -7.5880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1804   -6.7813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9618   -6.5308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5724   -7.0786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4016   -7.8811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6244   -8.1358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3537   -6.8240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9830   -7.2276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8990   -8.0421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1476   -8.3765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4843   -7.8922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5724   -7.0736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3197   -6.7433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7370   -8.2266    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  1  5  2  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
  7 12  2  0
  3 12  1  0
  4  6  1  0
  6 13  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 14 18  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 17 22  2  0
 18 19  2  0
 20 23  1  0
  2 15  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 24 29  2  0
 27 30  1  0
  5 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4529604

    ---

Associated Targets(non-human)

Aspergillus niger (16508 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 427.92Molecular Weight (Monoisotopic): 427.0546AlogP: 6.32#Rotatable Bonds: 2
Polar Surface Area: 47.78Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 1.09CX LogP: 7.09CX LogD: 7.09
Aromatic Rings: 5Heavy Atoms: 30QED Weighted: 0.32Np Likeness Score: -1.41

References

1. Khan I, Shareef MA, Kumar CG..  (2019)  An overview on the synthetic and medicinal perspectives of indenopyrazoles.,  178  [PMID:31167153] [10.1016/j.ejmech.2019.05.070]

Source