The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(2-(1,3-dioxo-1-phenylbutan-2-ylidene)hydrazineyl)-4-hydroxybenzene-1,3-disulfonic acid ID: ALA4529607
PubChem CID: 155545554
Max Phase: Preclinical
Molecular Formula: C16H14N2O9S2
Molecular Weight: 442.43
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)/C(=N\Nc1cc(S(=O)(=O)O)cc(S(=O)(=O)O)c1O)C(=O)c1ccccc1
Standard InChI: InChI=1S/C16H14N2O9S2/c1-9(19)14(15(20)10-5-3-2-4-6-10)18-17-12-7-11(28(22,23)24)8-13(16(12)21)29(25,26)27/h2-8,17,21H,1H3,(H,22,23,24)(H,25,26,27)/b18-14+
Standard InChI Key: ZKZRXFBZWUCICQ-NBVRZTHBSA-N
Molfile:
RDKit 2D
29 30 0 0 0 0 0 0 0 0999 V2000
6.9337 -9.6577 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3465 -8.9520 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.5289 -8.9474 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3494 -5.7822 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7621 -6.4921 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.1705 -5.7798 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6434 -6.9089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6423 -7.7285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3503 -8.1374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0600 -7.7280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0572 -6.9053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3485 -6.5001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3461 -5.6829 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4726 -6.9000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0577 -9.3634 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9356 -6.5005 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9354 -5.6833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2276 -5.2749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2274 -4.4577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5200 -5.6837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9350 -4.0489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5196 -4.0493 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8122 -5.2752 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5202 -6.5009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6422 -4.4603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3494 -4.0522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3496 -3.2341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6368 -2.8259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9326 -3.2363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
5 4 2 0
6 5 2 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
12 13 1 0
11 5 1 0
5 14 1 0
9 2 1 0
2 15 1 0
7 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
18 20 1 0
19 21 1 0
19 22 2 0
20 23 2 0
20 24 1 0
21 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 21 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 442.43Molecular Weight (Monoisotopic): 442.0141AlogP: 1.13#Rotatable Bonds: 7Polar Surface Area: 187.50Molecular Species: ACIDHBA: 9HBD: 4#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: -3.19CX Basic pKa: ┄CX LogP: -1.33CX LogD: -3.56Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.12Np Likeness Score: -0.62
References 1. Viswanathan A, Kute D, Musa A, Konda Mani S, Sipilä V, Emmert-Streib F, Zubkov FI, Gurbanov AV, Yli-Harja O, Kandhavelu M.. (2019) 2-(2-(2,4-dioxopentan-3-ylidene)hydrazineyl)benzonitrile as novel inhibitor of receptor tyrosine kinase and PI3K/AKT/mTOR signaling pathway in glioblastoma., 166 [PMID:30731398 ] [10.1016/j.ejmech.2019.01.021 ]