The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
rac-6-(Cyclopentyloxy)-7-methoxy-1-phenyl-N-(p-tolyl)-3,4-dihydroisoquinoline-3-carboxamide ID: ALA4529642
PubChem CID: 155545548
Max Phase: Preclinical
Molecular Formula: C29H30N2O3
Molecular Weight: 454.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1OC1CCCC1)CC(C(=O)Nc1ccc(C)cc1)N=C2c1ccccc1
Standard InChI: InChI=1S/C29H30N2O3/c1-19-12-14-22(15-13-19)30-29(32)25-16-21-17-27(34-23-10-6-7-11-23)26(33-2)18-24(21)28(31-25)20-8-4-3-5-9-20/h3-5,8-9,12-15,17-18,23,25H,6-7,10-11,16H2,1-2H3,(H,30,32)
Standard InChI Key: VMISFRHYDNYLNR-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
24.8934 -5.2081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8921 -6.0354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6070 -6.4483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6052 -4.7953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3205 -5.2044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3239 -6.0375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0431 -6.4488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7634 -6.0315 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.7600 -5.1985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0362 -4.7827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0453 -7.2737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1788 -4.7958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.1786 -3.9708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1774 -6.4473 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.4633 -6.0343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8518 -3.4870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5967 -2.7025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7716 -2.7027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5170 -3.4873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4732 -4.7839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1889 -5.1941 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.4707 -3.9589 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.9020 -4.7794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6173 -5.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3300 -4.7777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3279 -3.9518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6072 -3.5418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8974 -3.9581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0405 -3.5362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3319 -7.6881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3341 -8.5131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0497 -8.9237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7631 -8.5093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7609 -7.6843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
7 11 1 0
1 12 1 0
12 13 1 0
2 14 1 0
14 15 1 0
13 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 13 1 0
9 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
26 29 1 0
11 30 1 0
11 34 2 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 454.57Molecular Weight (Monoisotopic): 454.2256AlogP: 5.73#Rotatable Bonds: 6Polar Surface Area: 59.92Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.58CX Basic pKa: 3.24CX LogP: 6.39CX LogD: 6.39Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.52Np Likeness Score: -0.25
References 1. Liao Y, Jia X, Tang Y, Li S, Zang Y, Wang L, Cui ZN, Song G.. (2019) Discovery of novel inhibitors of phosphodiesterase 4 with 1-phenyl-3,4-dihydroisoquinoline scaffold: Structure-based drug design and fragment identification., 29 (22): [PMID:31610942 ] [10.1016/j.bmcl.2019.126720 ]