rac-6-(Cyclopentyloxy)-7-methoxy-1-phenyl-N-(p-tolyl)-3,4-dihydroisoquinoline-3-carboxamide

ID: ALA4529642

PubChem CID: 155545548

Max Phase: Preclinical

Molecular Formula: C29H30N2O3

Molecular Weight: 454.57

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc2c(cc1OC1CCCC1)CC(C(=O)Nc1ccc(C)cc1)N=C2c1ccccc1

Standard InChI:  InChI=1S/C29H30N2O3/c1-19-12-14-22(15-13-19)30-29(32)25-16-21-17-27(34-23-10-6-7-11-23)26(33-2)18-24(21)28(31-25)20-8-4-3-5-9-20/h3-5,8-9,12-15,17-18,23,25H,6-7,10-11,16H2,1-2H3,(H,30,32)

Standard InChI Key:  VMISFRHYDNYLNR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   24.8934   -5.2081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8921   -6.0354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6070   -6.4483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6052   -4.7953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3205   -5.2044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3239   -6.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0431   -6.4488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7634   -6.0315    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.7600   -5.1985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0362   -4.7827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0453   -7.2737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1788   -4.7958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.1786   -3.9708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1774   -6.4473    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.4633   -6.0343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8518   -3.4870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5967   -2.7025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7716   -2.7027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5170   -3.4873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4732   -4.7839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1889   -5.1941    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.4707   -3.9589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.9020   -4.7794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6173   -5.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3300   -4.7777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3279   -3.9518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6072   -3.5418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8974   -3.9581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0405   -3.5362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3319   -7.6881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3341   -8.5131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0497   -8.9237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7631   -8.5093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7609   -7.6843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
  7 11  1  0
  1 12  1  0
 12 13  1  0
  2 14  1  0
 14 15  1  0
 13 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 13  1  0
  9 20  1  0
 20 21  1  0
 20 22  2  0
 21 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 26 29  1  0
 11 30  1  0
 11 34  2  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4529642

    ---

Associated Targets(Human)

PDE4B Tclin Phosphodiesterase 4B (2748 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PDE4D Tclin Phosphodiesterase 4D (3546 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 454.57Molecular Weight (Monoisotopic): 454.2256AlogP: 5.73#Rotatable Bonds: 6
Polar Surface Area: 59.92Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.58CX Basic pKa: 3.24CX LogP: 6.39CX LogD: 6.39
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.52Np Likeness Score: -0.25

References

1. Liao Y, Jia X, Tang Y, Li S, Zang Y, Wang L, Cui ZN, Song G..  (2019)  Discovery of novel inhibitors of phosphodiesterase 4 with 1-phenyl-3,4-dihydroisoquinoline scaffold: Structure-based drug design and fragment identification.,  29  (22): [PMID:31610942] [10.1016/j.bmcl.2019.126720]

Source