2-[(2-Ethyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-ylmethylene)hydrazono]thiazolidin-4-one

ID: ALA4529644

PubChem CID: 155545550

Max Phase: Preclinical

Molecular Formula: C16H14N6OS2

Molecular Weight: 370.46

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCc1nn2c(/C=N/N=C3/NC(=O)CS3)c(-c3ccccc3)nc2s1

Standard InChI:  InChI=1S/C16H14N6OS2/c1-2-13-21-22-11(8-17-20-15-18-12(23)9-24-15)14(19-16(22)25-13)10-6-4-3-5-7-10/h3-8H,2,9H2,1H3,(H,18,20,23)/b17-8+

Standard InChI Key:  OFVLFLZBLMZJOO-CAOOACKPSA-N

Molfile:  

 
     RDKit          2D

 25 28  0  0  0  0  0  0  0  0999 V2000
   34.9062  -24.7202    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.8879  -23.3818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4170  -24.0578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6788  -23.6263    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.6879  -24.4518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4761  -24.7010    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   36.9557  -24.0270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4613  -23.3638    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.5963  -24.0704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1723  -23.3591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3477  -23.3702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9462  -24.0918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3711  -24.8037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1943  -24.7892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6224  -22.6006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8125  -22.4419    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.5470  -21.6606    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.7370  -21.5019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3852  -20.7561    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.5656  -20.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4069  -21.6641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1284  -22.0639    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   31.0069  -20.2479    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.7769  -24.0178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1954  -24.7244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  5  2  0
  4  2  1  0
  2  3  2  0
  3  1  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  4  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  3  9  1  0
  2 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 18  1  0
 20 23  2  0
  7 24  1  0
 24 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4529644

    ---

Associated Targets(non-human)

Trypanosoma brucei gambiense (523 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 370.46Molecular Weight (Monoisotopic): 370.0671AlogP: 2.57#Rotatable Bonds: 4
Polar Surface Area: 84.01Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 7.41CX Basic pKa: 1.96CX LogP: 3.06CX LogD: 2.77
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.57Np Likeness Score: -1.88

References

1. Kryshchyshyn A, Kaminskyy D, Karpenko O, Gzella A, Grellier P, Lesyk R..  (2019)  Thiazolidinone/thiazole based hybrids - New class of antitrypanosomal agents.,  174  [PMID:31051403] [10.1016/j.ejmech.2019.04.052]

Source