The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-{[2-(4-Chlorophenyl)-1H-indol-3-ylmethylene]hydrazono}-5-ethyl-3-(4-hydroxyphenyl)thiazolidin-4-one ID: ALA4529689
PubChem CID: 155545707
Max Phase: Preclinical
Molecular Formula: C26H21ClN4O2S
Molecular Weight: 489.00
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCC1S/C(=N\N=C\c2c(-c3ccc(Cl)cc3)[nH]c3ccccc23)N(c2ccc(O)cc2)C1=O
Standard InChI: InChI=1S/C26H21ClN4O2S/c1-2-23-25(33)31(18-11-13-19(32)14-12-18)26(34-23)30-28-15-21-20-5-3-4-6-22(20)29-24(21)16-7-9-17(27)10-8-16/h3-15,23,29,32H,2H2,1H3/b28-15+,30-26-
Standard InChI Key: KNPBSPLFCIODOC-QEKVHLCSSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
14.8393 -15.1188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6651 -15.1188 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
15.9222 -14.3339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2522 -13.8467 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.5865 -14.3339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7080 -14.0799 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.3208 -14.6332 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.1065 -14.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7195 -14.9326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9366 -15.4758 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.5246 -14.7602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3831 -16.0888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6306 -15.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9641 -16.2336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0486 -17.0539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8057 -17.3893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4691 -16.9046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8599 -14.0068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6825 -13.9216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0183 -13.1680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5326 -12.4990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7074 -12.5885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3754 -13.3423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8011 -14.0791 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2510 -13.0209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8674 -11.7441 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
15.9672 -12.6077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9663 -11.7827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2500 -11.3700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5331 -11.7885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5374 -12.6122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2476 -10.5442 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3531 -15.7863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5320 -15.6989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
3 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 13 1 0
12 10 1 0
10 11 1 0
11 9 2 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
11 18 1 0
5 24 2 0
4 25 1 0
21 26 1 0
25 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 25 1 0
29 32 1 0
1 33 1 0
33 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 489.00Molecular Weight (Monoisotopic): 488.1074AlogP: 6.44#Rotatable Bonds: 5Polar Surface Area: 81.05Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.66CX Basic pKa: ┄CX LogP: 6.42CX LogD: 6.39Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.25Np Likeness Score: -0.81
References 1. Kryshchyshyn A, Kaminskyy D, Karpenko O, Gzella A, Grellier P, Lesyk R.. (2019) Thiazolidinone/thiazole based hybrids - New class of antitrypanosomal agents., 174 [PMID:31051403 ] [10.1016/j.ejmech.2019.04.052 ]