2-{[2-(4-Chlorophenyl)-1H-indol-3-ylmethylene]hydrazono}-5-ethyl-3-(4-hydroxyphenyl)thiazolidin-4-one

ID: ALA4529689

PubChem CID: 155545707

Max Phase: Preclinical

Molecular Formula: C26H21ClN4O2S

Molecular Weight: 489.00

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCC1S/C(=N\N=C\c2c(-c3ccc(Cl)cc3)[nH]c3ccccc23)N(c2ccc(O)cc2)C1=O

Standard InChI:  InChI=1S/C26H21ClN4O2S/c1-2-23-25(33)31(18-11-13-19(32)14-12-18)26(34-23)30-28-15-21-20-5-3-4-6-22(20)29-24(21)16-7-9-17(27)10-8-16/h3-15,23,29,32H,2H2,1H3/b28-15+,30-26-

Standard InChI Key:  KNPBSPLFCIODOC-QEKVHLCSSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   14.8393  -15.1188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6651  -15.1188    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   15.9222  -14.3339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2522  -13.8467    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.5865  -14.3339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7080  -14.0799    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.3208  -14.6332    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.1065  -14.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7195  -14.9326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9366  -15.4758    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.5246  -14.7602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3831  -16.0888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6306  -15.7511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9641  -16.2336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0486  -17.0539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8057  -17.3893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4691  -16.9046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8599  -14.0068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6825  -13.9216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0183  -13.1680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5326  -12.4990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7074  -12.5885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3754  -13.3423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8011  -14.0791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2510  -13.0209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8674  -11.7441    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   15.9672  -12.6077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9663  -11.7827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2500  -11.3700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5331  -11.7885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5374  -12.6122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2476  -10.5442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3531  -15.7863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5320  -15.6989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  3  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 13  1  0
 12 10  1  0
 10 11  1  0
 11  9  2  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 11 18  1  0
  5 24  2  0
  4 25  1  0
 21 26  1  0
 25 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 25  1  0
 29 32  1  0
  1 33  1  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4529689

    ---

Associated Targets(non-human)

Trypanosoma brucei gambiense (523 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 489.00Molecular Weight (Monoisotopic): 488.1074AlogP: 6.44#Rotatable Bonds: 5
Polar Surface Area: 81.05Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.66CX Basic pKa: CX LogP: 6.42CX LogD: 6.39
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.25Np Likeness Score: -0.81

References

1. Kryshchyshyn A, Kaminskyy D, Karpenko O, Gzella A, Grellier P, Lesyk R..  (2019)  Thiazolidinone/thiazole based hybrids - New class of antitrypanosomal agents.,  174  [PMID:31051403] [10.1016/j.ejmech.2019.04.052]

Source