(R)-N-(3-fluoro-4-(2-((3aS,4S,6S,7aR)-3a,5,5-trimethylhexahydro-4,6-methanobenzo[d][1,3,2]dioxaborol-2-yl)pyrrolidine-1-carbonyl)phenyl)acetamide

ID: ALA4529691

PubChem CID: 155545709

Max Phase: Preclinical

Molecular Formula: C23H30BFN2O4

Molecular Weight: 428.31

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)Nc1ccc(C(=O)N2CCC[C@H]2B2O[C@@H]3C[C@@H]4C[C@@H](C4(C)C)[C@]3(C)O2)c(F)c1

Standard InChI:  InChI=1S/C23H30BFN2O4/c1-13(28)26-15-7-8-16(17(25)12-15)21(29)27-9-5-6-20(27)24-30-19-11-14-10-18(22(14,2)3)23(19,4)31-24/h7-8,12,14,18-20H,5-6,9-11H2,1-4H3,(H,26,28)/t14-,18-,19+,20-,23-/m0/s1

Standard InChI Key:  VRYJQJFTHFUANP-HVNOCCFSSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    3.5915  -13.1060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5902  -13.9339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3062  -14.3491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0196  -13.9335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0167  -13.1024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3044  -12.6949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8757  -12.6954    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1603  -13.1063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4447  -12.6957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1605  -13.9319    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7357  -14.3472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7370  -15.1728    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4506  -13.9312    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2021  -14.2630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7550  -13.6517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3389  -12.9367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5315  -13.1089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1940  -15.0850    0.0000 B   0  0  0  0  0  0  0  0  0  0  0  0
    6.5261  -15.5670    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8576  -15.5800    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5974  -16.3595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7764  -16.3510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3589  -17.0544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7618  -17.7706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0007  -17.0713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9493  -16.3503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4220  -16.3587    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1815  -17.0515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5922  -17.7651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3447  -18.4849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9327  -17.7651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0105  -18.4762    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.5333  -17.0494    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3070  -15.1741    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  2  0
  4 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 13  1  0
 14 18  1  1
 18 19  1  0
 19 22  1  0
 21 20  1  0
 20 18  1  0
 21 22  1  0
 21 25  1  0
 22 23  1  0
 23 24  1  0
 24 29  1  0
 29 25  1  0
 22 26  1  1
 21 27  1  1
 23 28  1  0
 29 28  1  0
 24 30  1  0
 24 31  1  0
 29 32  1  6
 23 33  1  6
  3 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4529691

    ---

Associated Targets(Human)

PREP Tchem Prolyl endopeptidase (1176 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 428.31Molecular Weight (Monoisotopic): 428.2283AlogP: #Rotatable Bonds:
Polar Surface Area: Molecular Species: HBA: HBD:
#RO5 Violations: HBA (Lipinski): HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: CX LogD:
Aromatic Rings: Heavy Atoms: QED Weighted: Np Likeness Score:

References

1. Plescia J, Dufresne C, Janmamode N, Wahba AS, Mittermaier AK, Moitessier N..  (2020)  Discovery of covalent prolyl oligopeptidase boronic ester inhibitors.,  185  [PMID:31732257] [10.1016/j.ejmech.2019.111783]

Source