1-ethyl-4-(morpholin-4-yl)-6-(2-phenyl-1H-imidazol-1-yl)-quinolin-2(1H)-one

ID: ALA4529757

PubChem CID: 134537480

Max Phase: Preclinical

Molecular Formula: C24H24N4O2

Molecular Weight: 400.48

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCn1c(=O)cc(N2CCOCC2)c2cc(-n3ccnc3-c3ccccc3)ccc21

Standard InChI:  InChI=1S/C24H24N4O2/c1-2-27-21-9-8-19(28-11-10-25-24(28)18-6-4-3-5-7-18)16-20(21)22(17-23(27)29)26-12-14-30-15-13-26/h3-11,16-17H,2,12-15H2,1H3

Standard InChI Key:  MXOATRGMRQFRTM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
   25.5638   -8.8349    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.5846   -9.4066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5846  -10.5498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5638  -11.1214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5839  -10.5498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5631  -11.1214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5832  -10.5498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5832   -9.4066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5631   -8.8349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5839   -9.4066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5624  -11.1214    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.4399  -12.3055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2967  -12.5097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7250  -11.5297    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.5008  -10.6723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2558   -9.5290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1133   -8.7533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8683   -7.6100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7659   -7.2834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9084   -8.0591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1534   -9.1616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5638  -12.3055    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.5846  -12.8772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5846  -14.0204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5638  -14.5920    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.5839  -14.0204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5839  -12.8772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5645   -8.8349    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.5638   -7.6508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5846   -7.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  1 10  1  0
  5 10  2  0
  7 11  1  0
 12 11  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
 15 11  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 16 21  2  0
  4 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 22 27  1  0
  2 28  2  0
  1 29  1  0
 29 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4529757

    ---

Associated Targets(Human)

HUVEC (11049 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 400.48Molecular Weight (Monoisotopic): 400.1899AlogP: 3.71#Rotatable Bonds: 4
Polar Surface Area: 52.29Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.51CX LogP: 2.81CX LogD: 2.81
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.52Np Likeness Score: -1.57

References

1.  (2018)  Nitrogen-containing heterocyclic compound, 

Source