The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(4-Fluorobenzamido)-N,N-dimethyl-1-propyl-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide ID: ALA4529866
PubChem CID: 146597666
Max Phase: Preclinical
Molecular Formula: C20H25FN4O2
Molecular Weight: 372.44
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCn1nc(C(=O)N(C)C)c2c1CCC(NC(=O)c1ccc(F)cc1)C2
Standard InChI: InChI=1S/C20H25FN4O2/c1-4-11-25-17-10-9-15(12-16(17)18(23-25)20(27)24(2)3)22-19(26)13-5-7-14(21)8-6-13/h5-8,15H,4,9-12H2,1-3H3,(H,22,26)
Standard InChI Key: VYXYWEODDXYKMZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 29 0 0 0 0 0 0 0 0999 V2000
41.3920 -17.2559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3920 -18.0773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1014 -18.4859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1014 -16.8432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.5858 -18.3227 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.0666 -17.6642 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.5834 -17.0033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8067 -17.2559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8081 -18.0730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8387 -16.2215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.6418 -16.0502 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.2920 -15.6141 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.8937 -15.2728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.1891 -16.6570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8388 -19.0998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2923 -19.7074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.5453 -20.4844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6836 -16.8485 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.9766 -17.2583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2682 -16.8509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2713 -16.0361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5637 -15.6288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8557 -16.0386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8597 -16.8600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5679 -17.2637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1468 -15.6321 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
39.9779 -18.0755 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 9 1 0
8 4 1 0
8 9 2 0
6 7 2 0
5 6 1 0
7 8 1 0
9 5 1 0
7 10 1 0
10 11 1 0
10 12 2 0
11 13 1 0
11 14 1 0
5 15 1 0
15 16 1 0
16 17 1 0
1 18 1 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
23 26 1 0
19 27 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 372.44Molecular Weight (Monoisotopic): 372.1962AlogP: 2.42#Rotatable Bonds: 5Polar Surface Area: 67.23Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 0.01CX LogP: 2.50CX LogD: 2.50Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.88Np Likeness Score: -2.05
References 1. Iyamu ID, Lv W, Malik N, Mishra RK, Schiltz GE.. (2019) Discovery of a novel class of potent and selective tetrahydroindazole-based sigma-1 receptor ligands., 27 (9): [PMID:30904383 ] [10.1016/j.bmc.2019.03.030 ]