The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((3aS,4R,8aS,8bR)-2-(2,4-difluorobenzyl)-1,3-dioxodecahydropyrrolo[3,4-a]pyrrolizin-4-yl)benzimidamide hydrochloride ID: ALA4529907
PubChem CID: 155545696
Max Phase: Preclinical
Molecular Formula: C23H23ClF2N4O2
Molecular Weight: 424.45
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cl.N=C(N)c1ccc([C@H]2[C@H]3C(=O)N(Cc4ccc(F)cc4F)C(=O)[C@H]3[C@@H]3CCCN32)cc1
Standard InChI: InChI=1S/C23H22F2N4O2.ClH/c24-15-8-7-14(16(25)10-15)11-29-22(30)18-17-2-1-9-28(17)20(19(18)23(29)31)12-3-5-13(6-4-12)21(26)27;/h3-8,10,17-20H,1-2,9,11H2,(H3,26,27);1H/t17-,18-,19-,20-;/m0./s1
Standard InChI Key: LRALJYUILNELMH-NAACWRBGSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
1.6156 -6.7474 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.2547 -5.3448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0719 -5.3448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4786 -6.0548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2950 -6.0551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7045 -5.3469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2915 -4.6368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4764 -4.6400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8461 -4.6371 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.8461 -6.0525 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5216 -5.3458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7791 -5.7499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0031 -6.0060 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0069 -6.8232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7853 -7.0721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2624 -6.4088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0005 -4.6813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7740 -4.9307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2502 -4.2721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7710 -3.6156 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9987 -3.8686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3364 -3.3898 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0674 -4.2702 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5623 -5.1384 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.2056 -4.4657 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.0217 -2.8378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8206 -2.6660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3631 -3.2734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1613 -3.1021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4127 -2.3236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8597 -1.7162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0635 -1.8906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5953 -5.7492 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.5116 -1.2880 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.2114 -2.1508 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
2 9 1 0
2 10 2 0
11 6 1 1
11 13 1 0
12 18 1 0
17 11 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 17 1 0
21 22 2 0
19 23 2 0
18 24 1 6
17 25 1 6
20 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
12 16 1 0
12 33 1 1
32 34 1 0
30 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 424.45Molecular Weight (Monoisotopic): 424.1711AlogP: 2.57#Rotatable Bonds: 4Polar Surface Area: 90.49Molecular Species: BASEHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 11.49CX LogP: 2.16CX LogD: -2.42Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.45Np Likeness Score: -0.64