The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-hydroxy-4-(2-methoxy-5-(2-methyl-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-en-1-yl)phenoxy)butanamide ID: ALA4530175
PubChem CID: 155545823
Max Phase: Preclinical
Molecular Formula: C24H29NO8
Molecular Weight: 459.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(/C=C(\C)C(=O)c2cc(OC)c(OC)c(OC)c2)cc1OCCCC(=O)NO
Standard InChI: InChI=1S/C24H29NO8/c1-15(23(27)17-13-20(30-3)24(32-5)21(14-17)31-4)11-16-8-9-18(29-2)19(12-16)33-10-6-7-22(26)25-28/h8-9,11-14,28H,6-7,10H2,1-5H3,(H,25,26)/b15-11+
Standard InChI Key: SKWOXITZTDAWTM-RVDMUPIBSA-N
Molfile:
RDKit 2D
33 34 0 0 0 0 0 0 0 0999 V2000
4.3858 -14.7672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3847 -15.5867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0927 -15.9957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8024 -15.5862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7996 -14.7636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0909 -14.3583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0925 -16.8129 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8001 -17.2216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6767 -15.9948 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9693 -15.5856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6780 -14.3588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9704 -14.7675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5057 -14.3523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2150 -14.7583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5026 -13.5351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9211 -14.3470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6304 -14.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6304 -15.5690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3388 -15.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0459 -15.5635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0402 -14.7421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3312 -14.3400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7557 -15.9685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4613 -15.5563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7449 -14.3284 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4556 -14.7318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1603 -14.3180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8709 -14.7215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5757 -14.3077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2863 -14.7111 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.5697 -13.4905 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.9910 -14.2974 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2180 -15.5754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
7 8 1 0
2 9 1 0
9 10 1 0
1 11 1 0
11 12 1 0
5 13 1 0
13 14 1 0
13 15 2 0
14 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
20 23 1 0
23 24 1 0
21 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
29 31 2 0
30 32 1 0
14 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 459.50Molecular Weight (Monoisotopic): 459.1893AlogP: 3.67#Rotatable Bonds: 12Polar Surface Area: 112.55Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.91CX Basic pKa: ┄CX LogP: 2.69CX LogD: 2.68Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.16Np Likeness Score: 0.01
References 1. Wang B, Chen X, Gao J, Su L, Zhang L, Xu H, Luan Y.. (2019) Anti-tumor activity evaluation of novel tubulin and HDAC dual-targeting inhibitors., 29 (18): [PMID:31400938 ] [10.1016/j.bmcl.2019.07.045 ]