N'-benzylidene-4-(4,6-di(piperidin-1-yl)-1,3,5-triazin-2-ylamino)benzohydrazide

ID: ALA4530185

PubChem CID: 155545896

Max Phase: Preclinical

Molecular Formula: C27H32N8O

Molecular Weight: 484.61

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(N/N=C/c1ccccc1)c1ccc(Nc2nc(N3CCCCC3)nc(N3CCCCC3)n2)cc1

Standard InChI:  InChI=1S/C27H32N8O/c36-24(33-28-20-21-10-4-1-5-11-21)22-12-14-23(15-13-22)29-25-30-26(34-16-6-2-7-17-34)32-27(31-25)35-18-8-3-9-19-35/h1,4-5,10-15,20H,2-3,6-9,16-19H2,(H,33,36)(H,29,30,31,32)/b28-20+

Standard InChI Key:  YKVIBWUHKJCFMC-VFCFBJKWSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
    4.6747   -5.7905    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6736   -6.6100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3816   -7.0190    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0913   -6.6095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0885   -5.7869    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3798   -5.3816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7996   -7.0170    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5067   -6.6073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2117   -7.0152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9183   -6.6062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9175   -5.7881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2041   -5.3808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5005   -5.7922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6240   -5.3775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3329   -5.7840    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6216   -4.5603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0394   -5.3734    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.7483   -5.7799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4548   -5.3693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1605   -5.7758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8665   -5.3658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8646   -4.5478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1507   -4.1414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4476   -4.5537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9656   -7.0180    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3774   -4.5644    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0841   -4.1606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0836   -3.3470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3765   -2.9366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6682   -3.3461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6671   -4.1659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2619   -6.6044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5560   -7.0090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5511   -7.8265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2583   -8.2379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9704   -7.8317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
 11 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
  2 25  1  0
  6 26  1  0
 26 27  1  0
 26 31  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 25 32  1  0
 25 36  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4530185

    ---

Associated Targets(non-human)

Klebsiella pneumoniae (43867 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Vero (26788 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 484.61Molecular Weight (Monoisotopic): 484.2699AlogP: 4.36#Rotatable Bonds: 7
Polar Surface Area: 98.64Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.92CX Basic pKa: 7.39CX LogP: 6.24CX LogD: 5.95
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.38Np Likeness Score: -1.54

References

1. Liu H, Long S, Rakesh KP, Zha GF..  (2020)  Structure-activity relationships (SAR) of triazine derivatives: Promising antimicrobial agents.,  185  [PMID:31675510] [10.1016/j.ejmech.2019.111804]

Source