The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,2'S)-3,3'-((((Azanediylbis(methylene))bis(1H-1,2,3-triazole-4,1-diyl))bis(2,1-phenylene))bis(oxy))bis(1-(isopropylamino)propan-2-ol) ID: ALA4530266
PubChem CID: 155545790
Max Phase: Preclinical
Molecular Formula: C30H43N9O4
Molecular Weight: 593.73
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)NC[C@H](O)COc1ccccc1-n1cc(CNCc2cn(-c3ccccc3OC[C@@H](O)CNC(C)C)nn2)nn1
Standard InChI: InChI=1S/C30H43N9O4/c1-21(2)32-15-25(40)19-42-29-11-7-5-9-27(29)38-17-23(34-36-38)13-31-14-24-18-39(37-35-24)28-10-6-8-12-30(28)43-20-26(41)16-33-22(3)4/h5-12,17-18,21-22,25-26,31-33,40-41H,13-16,19-20H2,1-4H3/t25-,26-/m0/s1
Standard InChI Key: VBSMKEQICRNWJO-UIOOFZCWSA-N
Molfile:
RDKit 2D
43 46 0 0 0 0 0 0 0 0999 V2000
7.5817 -16.7896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2894 -16.3810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9971 -16.7896 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7048 -16.3810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4126 -16.7896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5021 -17.5977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3014 -17.7676 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7100 -17.0599 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1631 -16.4527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8334 -16.4613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2866 -17.0686 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6952 -17.7764 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4945 -17.6064 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5261 -17.0578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4686 -17.0661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0637 -16.3541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2464 -16.3512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8344 -17.0589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2456 -17.7709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0615 -17.7703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9341 -17.7659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7495 -17.7642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1566 -17.0559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7424 -16.3478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9284 -16.3530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4758 -15.6485 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0708 -14.9387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4829 -14.2331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0779 -13.5233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4900 -12.8177 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3072 -12.8218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7193 -12.1161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7122 -13.5315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3001 -14.2372 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5158 -15.6476 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9203 -14.9376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5077 -14.2322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9122 -13.5222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4996 -12.8168 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6905 -14.2368 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9042 -12.1068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4915 -11.4014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7213 -12.1021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 1 0
9 5 2 0
1 10 2 0
10 11 1 0
11 12 1 0
12 13 2 0
13 1 1 0
8 14 1 0
11 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
14 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 14 1 0
16 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
31 33 1 0
28 34 1 6
25 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
37 40 1 1
39 41 1 0
41 42 1 0
41 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 593.73Molecular Weight (Monoisotopic): 593.3438AlogP: 1.61#Rotatable Bonds: 18Polar Surface Area: 156.43Molecular Species: BASEHBA: 13HBD: 5#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.79CX Basic pKa: 9.97CX LogP: 2.07CX LogD: -2.38Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.11Np Likeness Score: -0.80
References 1. Gaiser BI, Danielsen M, Marcher-Rørsted E, Røpke Jørgensen K, Wróbel TM, Frykman M, Johansson H, Bräuner-Osborne H, Gloriam DE, Mathiesen JM, Sejer Pedersen D.. (2019) Probing the Existence of a Metastable Binding Site at the β2 -Adrenergic Receptor with Homobivalent Bitopic Ligands., 62 (17): [PMID:31298548 ] [10.1021/acs.jmedchem.9b00595 ]