(2S,2'S)-3,3'-((((Azanediylbis(methylene))bis(1H-1,2,3-triazole-4,1-diyl))bis(2,1-phenylene))bis(oxy))bis(1-(isopropylamino)propan-2-ol)

ID: ALA4530266

PubChem CID: 155545790

Max Phase: Preclinical

Molecular Formula: C30H43N9O4

Molecular Weight: 593.73

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)NC[C@H](O)COc1ccccc1-n1cc(CNCc2cn(-c3ccccc3OC[C@@H](O)CNC(C)C)nn2)nn1

Standard InChI:  InChI=1S/C30H43N9O4/c1-21(2)32-15-25(40)19-42-29-11-7-5-9-27(29)38-17-23(34-36-38)13-31-14-24-18-39(37-35-24)28-10-6-8-12-30(28)43-20-26(41)16-33-22(3)4/h5-12,17-18,21-22,25-26,31-33,40-41H,13-16,19-20H2,1-4H3/t25-,26-/m0/s1

Standard InChI Key:  VBSMKEQICRNWJO-UIOOFZCWSA-N

Molfile:  

 
     RDKit          2D

 43 46  0  0  0  0  0  0  0  0999 V2000
    7.5817  -16.7896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2894  -16.3810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9971  -16.7896    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7048  -16.3810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4126  -16.7896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5021  -17.5977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3014  -17.7676    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.7100  -17.0599    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.1631  -16.4527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8334  -16.4613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2866  -17.0686    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6952  -17.7764    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4945  -17.6064    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.5261  -17.0578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4686  -17.0661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0637  -16.3541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2464  -16.3512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8344  -17.0589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2456  -17.7709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0615  -17.7703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9341  -17.7659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7495  -17.7642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1566  -17.0559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7424  -16.3478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9284  -16.3530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4758  -15.6485    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0708  -14.9387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4829  -14.2331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0779  -13.5233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4900  -12.8177    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3072  -12.8218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7193  -12.1161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7122  -13.5315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3001  -14.2372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5158  -15.6476    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9203  -14.9376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5077  -14.2322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9122  -13.5222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4996  -12.8168    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.6905  -14.2368    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9042  -12.1068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4915  -11.4014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7213  -12.1021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9  5  2  0
  1 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13  1  1  0
  8 14  1  0
 11 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 14 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 14  1  0
 16 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  1  0
 28 34  1  6
 25 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 37 40  1  1
 39 41  1  0
 41 42  1  0
 41 43  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4530266

    ---

Associated Targets(Human)

ADRB2 Tclin Beta-2 adrenergic receptor (11824 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ADRB1 Tclin Beta-1 adrenergic receptor (6630 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 593.73Molecular Weight (Monoisotopic): 593.3438AlogP: 1.61#Rotatable Bonds: 18
Polar Surface Area: 156.43Molecular Species: BASEHBA: 13HBD: 5
#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 5#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.79CX Basic pKa: 9.97CX LogP: 2.07CX LogD: -2.38
Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.11Np Likeness Score: -0.80

References

1. Gaiser BI, Danielsen M, Marcher-Rørsted E, Røpke Jørgensen K, Wróbel TM, Frykman M, Johansson H, Bräuner-Osborne H, Gloriam DE, Mathiesen JM, Sejer Pedersen D..  (2019)  Probing the Existence of a Metastable Binding Site at the β2-Adrenergic Receptor with Homobivalent Bitopic Ligands.,  62  (17): [PMID:31298548] [10.1021/acs.jmedchem.9b00595]

Source