The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl ((1S,2R)-2-((S)-2-(Azetidin-1-yl)-1-(1-((1-(4-((1-((E)-4-(3,3-difluoroazetidin-1-yl)but-2-enoyl)azetidin-3-yl)sulfonyl)phenyl)azetidin-3-yl)methyl)piperidin-4-yl)-1-(3-fluorophenyl)ethyl)cyclopentyl)carbamate ID: ALA4530300
PubChem CID: 155545749
Max Phase: Preclinical
Molecular Formula: C43H57F3N6O5S
Molecular Weight: 827.03
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)N[C@H]1CCC[C@@H]1[C@](CN1CCC1)(c1cccc(F)c1)C1CCN(CC2CN(c3ccc(S(=O)(=O)C4CN(C(=O)/C=C/CN5CC(F)(F)C5)C4)cc3)C2)CC1
Standard InChI: InChI=1S/C43H57F3N6O5S/c1-57-41(54)47-39-9-3-8-38(39)43(30-49-18-5-19-49,33-6-2-7-34(44)22-33)32-15-20-48(21-16-32)23-31-24-51(25-31)35-11-13-36(14-12-35)58(55,56)37-26-52(27-37)40(53)10-4-17-50-28-42(45,46)29-50/h2,4,6-7,10-14,22,31-32,37-39H,3,5,8-9,15-21,23-30H2,1H3,(H,47,54)/b10-4+/t38-,39-,43-/m0/s1
Standard InChI Key: LAHJBSUOBULURD-HHKHNSFJSA-N
Molfile:
RDKit 2D
59 66 0 0 0 0 0 0 0 0999 V2000
18.6509 -2.9551 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.2465 -3.6650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0635 -3.6603 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.0930 -5.5305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6596 -4.6555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4147 -6.3642 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0102 -5.6584 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.6013 -6.3616 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8874 -4.4285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8863 -5.2480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5943 -5.6611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3040 -5.2475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3012 -4.4249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5925 -4.0237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7194 -5.2453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5000 -5.4623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7144 -4.6726 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9247 -4.4582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4214 -4.2588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1256 -4.6704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4201 -3.4416 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8368 -4.2566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5452 -4.6682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2523 -4.2544 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1843 -4.0233 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9746 -3.2367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1892 -3.4433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3999 -4.2287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4860 -3.0381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7820 -3.4419 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0730 -3.0373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3711 -3.4376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3660 -4.2510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0690 -4.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7812 -4.2564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9589 -4.2442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9623 -3.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2615 -3.0237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5550 -3.4248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5537 -4.2421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2551 -4.6503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2658 -2.2106 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.7639 -6.2702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3626 -6.8123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0642 -6.4120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9017 -5.6199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3047 -5.6213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4875 -5.5878 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4975 -4.8206 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.6036 -5.2044 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3157 -5.6053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0189 -5.1890 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3246 -6.4224 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7310 -5.5899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9328 -4.9924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3313 -5.5466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8855 -6.1481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0412 -4.4613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4559 -3.4613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 1 0
7 6 2 0
8 7 2 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
12 7 1 0
7 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 15 1 0
17 19 1 0
19 20 1 0
19 21 2 0
20 22 2 0
22 23 1 0
23 24 1 0
9 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 25 1 0
27 29 1 0
29 30 1 0
30 31 1 0
30 35 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
33 5 1 0
5 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
38 42 1 0
4 43 1 0
43 44 1 0
44 45 1 0
45 46 1 0
46 4 1 0
5 47 1 1
47 48 1 0
4 49 1 1
46 50 1 1
50 51 1 0
51 52 1 0
51 53 2 0
52 54 1 0
48 55 1 0
55 56 1 0
56 57 1 0
57 48 1 0
24 58 1 0
58 2 1 0
2 59 1 0
59 24 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 827.03Molecular Weight (Monoisotopic): 826.4063AlogP: 4.63#Rotatable Bonds: 14Polar Surface Area: 105.74Molecular Species: BASEHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.94CX LogP: 4.30CX LogD: 2.30Aromatic Rings: 2Heavy Atoms: 58QED Weighted: 0.27Np Likeness Score: -0.98
References 1. Xu S, Aguilar A, Huang L, Xu T, Zheng K, McEachern D, Przybranowski S, Foster C, Zawacki K, Liu Z, Chinnaswamy K, Stuckey J, Wang S.. (2020) Discovery of M-808 as a Highly Potent, Covalent, Small-Molecule Inhibitor of the Menin-MLL Interaction with Strong In Vivo Antitumor Activity., 63 (9): [PMID:32338903 ] [10.1021/acs.jmedchem.0c00547 ]
