3-methoxy-4-(5-(4-(5-(3-nitrophenyl)-1,3,4-thiadiazol-2-yl)phenyl)-1,3,4-oxadiazol-2-yl)phenol

ID: ALA4530325

PubChem CID: 155545880

Max Phase: Preclinical

Molecular Formula: C23H15N5O5S

Molecular Weight: 473.47

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(O)ccc1-c1nnc(-c2ccc(-c3nnc(-c4cccc([N+](=O)[O-])c4)s3)cc2)o1

Standard InChI:  InChI=1S/C23H15N5O5S/c1-32-19-12-17(29)9-10-18(19)21-25-24-20(33-21)13-5-7-14(8-6-13)22-26-27-23(34-22)15-3-2-4-16(11-15)28(30)31/h2-12,29H,1H3

Standard InChI Key:  PDMDRKQRTBIPCV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   41.3080   -9.9094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.3069  -10.7290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0149  -11.1379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7246  -10.7285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7217   -9.9058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0131   -9.5006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5988  -11.1370    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.0107   -8.6834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.3018   -8.2769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.4257   -9.4962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.1735   -9.8258    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   44.7180   -9.2164    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   44.3067   -8.5102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.4503   -8.6832    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.6332   -7.7644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.4468   -7.6770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.7763   -6.9301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.2933   -6.2698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.4770   -6.3615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.1512   -7.1086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.6181   -5.5231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.4165   -5.3491    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   46.4978   -4.5359    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   45.7494   -4.2074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.2059   -4.7887    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   45.5850   -3.4069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.1970   -2.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.0330   -2.0669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.2569   -1.8084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.6445   -2.3558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.8116   -3.1536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.6410   -1.5224    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   46.4770   -0.7226    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   47.4164   -1.7806    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  6  8  1  0
  8  9  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 10  1  0
  5 10  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 13 15  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 21  1  0
 18 21  1  0
 24 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 32 33  2  0
 32 34  1  0
 28 32  1  0
M  CHG  2  32   1  34  -1
M  END

Alternative Forms

  1. Parent:

    ALA4530325

    ---

Associated Targets(Human)

GUSB Tchem Beta-glucuronidase (537 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 473.47Molecular Weight (Monoisotopic): 473.0794AlogP: 5.21#Rotatable Bonds: 6
Polar Surface Area: 137.30Molecular Species: NEUTRALHBA: 10HBD: 1
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.53CX Basic pKa: CX LogP: 4.31CX LogD: 4.28
Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.26Np Likeness Score: -0.95

References

1. Taha M, Imran S, Alomari M, Rahim F, Wadood A, Mosaddik A, Uddin N, Gollapalli M, Alqahtani MA, Bamarouf YA..  (2019)  Synthesis of oxadiazole-coupled-thiadiazole derivatives as a potent β-glucuronidase inhibitors and their molecular docking study.,  27  (14): [PMID:31196753] [10.1016/j.bmc.2019.05.049]

Source