The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-methoxy-4-(5-(4-(5-(3-nitrophenyl)-1,3,4-thiadiazol-2-yl)phenyl)-1,3,4-oxadiazol-2-yl)phenol ID: ALA4530325
PubChem CID: 155545880
Max Phase: Preclinical
Molecular Formula: C23H15N5O5S
Molecular Weight: 473.47
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(O)ccc1-c1nnc(-c2ccc(-c3nnc(-c4cccc([N+](=O)[O-])c4)s3)cc2)o1
Standard InChI: InChI=1S/C23H15N5O5S/c1-32-19-12-17(29)9-10-18(19)21-25-24-20(33-21)13-5-7-14(8-6-13)22-26-27-23(34-22)15-3-2-4-16(11-15)28(30)31/h2-12,29H,1H3
Standard InChI Key: PDMDRKQRTBIPCV-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
41.3080 -9.9094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3069 -10.7290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0149 -11.1379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7246 -10.7285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7217 -9.9058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0131 -9.5006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5988 -11.1370 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.0107 -8.6834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.3018 -8.2769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4257 -9.4962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.1735 -9.8258 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.7180 -9.2164 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.3067 -8.5102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4503 -8.6832 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.6332 -7.7644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.4468 -7.6770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.7763 -6.9301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.2933 -6.2698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.4770 -6.3615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.1512 -7.1086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.6181 -5.5231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.4165 -5.3491 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
46.4978 -4.5359 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
45.7494 -4.2074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.2059 -4.7887 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
45.5850 -3.4069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.1970 -2.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.0330 -2.0669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.2569 -1.8084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.6445 -2.3558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.8116 -3.1536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.6410 -1.5224 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
46.4770 -0.7226 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
47.4164 -1.7806 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
6 8 1 0
8 9 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 10 1 0
5 10 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
13 15 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 21 1 0
18 21 1 0
24 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
32 33 2 0
32 34 1 0
28 32 1 0
M CHG 2 32 1 34 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 473.47Molecular Weight (Monoisotopic): 473.0794AlogP: 5.21#Rotatable Bonds: 6Polar Surface Area: 137.30Molecular Species: NEUTRALHBA: 10HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.53CX Basic pKa: ┄CX LogP: 4.31CX LogD: 4.28Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.26Np Likeness Score: -0.95
References 1. Taha M, Imran S, Alomari M, Rahim F, Wadood A, Mosaddik A, Uddin N, Gollapalli M, Alqahtani MA, Bamarouf YA.. (2019) Synthesis of oxadiazole-coupled-thiadiazole derivatives as a potent β-glucuronidase inhibitors and their molecular docking study., 27 (14): [PMID:31196753 ] [10.1016/j.bmc.2019.05.049 ]