The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,6-di-tert-butyl-4-((4-methoxyphenyl)(morpholino)methyl)phenol ID: ALA4530378
Cas Number: 5813-21-8
PubChem CID: 2870829
Max Phase: Preclinical
Molecular Formula: C26H37NO3
Molecular Weight: 411.59
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C(c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)N2CCOCC2)cc1
Standard InChI: InChI=1S/C26H37NO3/c1-25(2,3)21-16-19(17-22(24(21)28)26(4,5)6)23(27-12-14-30-15-13-27)18-8-10-20(29-7)11-9-18/h8-11,16-17,23,28H,12-15H2,1-7H3
Standard InChI Key: FLXFPVCPLOGQHI-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
12.5247 -23.7204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2393 -23.3079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8103 -23.3079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5247 -24.5454 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9522 -23.7251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6663 -23.3133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6667 -22.4874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9472 -22.0751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2362 -22.4893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8153 -22.4819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1017 -22.0694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3862 -22.4820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3889 -23.3113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1031 -23.7199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8125 -24.9544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8105 -25.7757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5231 -26.1922 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2394 -25.7809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2430 -24.9533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3806 -22.0740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6713 -22.0704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1021 -21.2445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8167 -20.8323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3878 -20.8316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0956 -20.4163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6759 -23.7263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9600 -23.3163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6788 -24.5513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9581 -24.1329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0956 -22.4856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 1 0
2 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 2 1 0
3 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 3 1 0
4 15 1 0
4 19 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
7 20 1 0
12 21 1 0
11 22 1 0
22 23 1 0
22 24 1 0
22 25 1 0
13 26 1 0
26 27 1 0
26 28 1 0
26 29 1 0
20 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 411.59Molecular Weight (Monoisotopic): 411.2773AlogP: 5.42#Rotatable Bonds: 4Polar Surface Area: 41.93Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.73CX Basic pKa: 6.30CX LogP: 6.11CX LogD: 6.08Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.73Np Likeness Score: -0.62
References 1. (2012) Entpd5 inhibitors,