2,6-di-tert-butyl-4-((4-methoxyphenyl)(morpholino)methyl)phenol

ID: ALA4530378

Cas Number: 5813-21-8

PubChem CID: 2870829

Max Phase: Preclinical

Molecular Formula: C26H37NO3

Molecular Weight: 411.59

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(C(c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)N2CCOCC2)cc1

Standard InChI:  InChI=1S/C26H37NO3/c1-25(2,3)21-16-19(17-22(24(21)28)26(4,5)6)23(27-12-14-30-15-13-27)18-8-10-20(29-7)11-9-18/h8-11,16-17,23,28H,12-15H2,1-7H3

Standard InChI Key:  FLXFPVCPLOGQHI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   12.5247  -23.7204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2393  -23.3079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8103  -23.3079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5247  -24.5454    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.9522  -23.7251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6663  -23.3133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6667  -22.4874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9472  -22.0751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2362  -22.4893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8153  -22.4819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1017  -22.0694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3862  -22.4820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3889  -23.3113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1031  -23.7199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8125  -24.9544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8105  -25.7757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5231  -26.1922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2394  -25.7809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2430  -24.9533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3806  -22.0740    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6713  -22.0704    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1021  -21.2445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8167  -20.8323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3878  -20.8316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0956  -20.4163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6759  -23.7263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9600  -23.3163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6788  -24.5513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9581  -24.1329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0956  -22.4856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  1  4  1  0
  2  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  2  1  0
  3 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  3  1  0
  4 15  1  0
  4 19  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
  7 20  1  0
 12 21  1  0
 11 22  1  0
 22 23  1  0
 22 24  1  0
 22 25  1  0
 13 26  1  0
 26 27  1  0
 26 28  1  0
 26 29  1  0
 20 30  1  0
M  END

Associated Targets(Human)

ENTPD5 Tbio Ectonucleoside triphosphate diphosphohydrolase 5 (478 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

pyrH Uridylate kinase (158 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 411.59Molecular Weight (Monoisotopic): 411.2773AlogP: 5.42#Rotatable Bonds: 4
Polar Surface Area: 41.93Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.73CX Basic pKa: 6.30CX LogP: 6.11CX LogD: 6.08
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.73Np Likeness Score: -0.62

References

1.  (2012)  Entpd5 inhibitors, 

Source