The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-Methoxy-2-(3,4,5-trimethoxybenzyl)naphthalen-1-ol ID: ALA4530424
PubChem CID: 155545768
Max Phase: Preclinical
Molecular Formula: C21H22O5
Molecular Weight: 354.40
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2c(O)c(Cc3cc(OC)c(OC)c(OC)c3)ccc2c1
Standard InChI: InChI=1S/C21H22O5/c1-23-16-7-8-17-14(12-16)5-6-15(20(17)22)9-13-10-18(24-2)21(26-4)19(11-13)25-3/h5-8,10-12,22H,9H2,1-4H3
Standard InChI Key: VYFWBHVSCDXHCW-UHFFFAOYSA-N
Molfile:
RDKit 2D
26 28 0 0 0 0 0 0 0 0999 V2000
4.2785 -1.8036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2774 -2.6231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9854 -3.0321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9836 -1.3947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5693 -3.0311 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8620 -2.6220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6900 -1.7994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6911 -2.6252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4055 -3.0353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1195 -2.6209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1144 -1.7920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3993 -1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3947 -0.5684 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8195 -1.3789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5298 -1.7829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5335 -2.5971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2430 -3.0010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9490 -2.5878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9411 -1.7665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2310 -1.3662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6447 -1.3508 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3564 -1.7524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6599 -2.9909 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6662 -3.8081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2478 -3.8182 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5426 -4.2310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 8 2 0
7 4 2 0
4 1 1 0
2 5 1 0
5 6 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
12 13 1 0
11 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
19 21 1 0
21 22 1 0
18 23 1 0
23 24 1 0
17 25 1 0
25 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 354.40Molecular Weight (Monoisotopic): 354.1467AlogP: 4.17#Rotatable Bonds: 6Polar Surface Area: 57.15Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.81CX Basic pKa: ┄CX LogP: 4.12CX LogD: 4.12Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.72Np Likeness Score: 0.35
References 1. Maguire CJ, Carlson GJ, Ford JW, Strecker TE, Hamel E, Trawick ML, Pinney KG.. (2019) Synthesis and biological evaluation of structurally diverse α-conformationally restricted chalcones and related analogues., 10 (8): [PMID:31534659 ] [10.1039/C9MD00127A ]