The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-chloro-4-fluorophenyl)-1-(3-chloro-4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1H-1,2,4-triazole-3-carboxamide ID: ALA4530425
PubChem CID: 155545769
Max Phase: Preclinical
Molecular Formula: C25H21Cl2FN4O5
Molecular Weight: 547.37
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-n2nc(C(=O)Nc3ccc(F)c(Cl)c3)nc2-c2cc(OC)c(OC)c(OC)c2)cc1Cl
Standard InChI: InChI=1S/C25H21Cl2FN4O5/c1-34-19-8-6-15(12-17(19)27)32-24(13-9-20(35-2)22(37-4)21(10-13)36-3)30-23(31-32)25(33)29-14-5-7-18(28)16(26)11-14/h5-12H,1-4H3,(H,29,33)
Standard InChI Key: WZSCQBSQEUBGGV-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
20.9797 -25.8195 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.1973 -25.5565 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7065 -26.2201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1813 -26.8934 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.9701 -26.6447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6336 -27.1354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5383 -27.9554 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.2006 -28.4500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1053 -29.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7680 -29.7593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5240 -29.4288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6171 -28.6044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9535 -28.1175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3912 -26.8103 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8834 -26.2103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4767 -25.4920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6522 -25.4821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2322 -26.1937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6428 -26.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4671 -26.9192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2221 -27.6279 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.6321 -28.3432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4070 -26.1852 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9888 -26.8968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2464 -24.7612 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4199 -24.7552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9501 -24.7703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5129 -24.1629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2648 -23.3746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4571 -23.1978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9005 -23.8075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1476 -24.5922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0930 -23.6341 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
19.2085 -22.4151 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.4062 -22.2391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3695 -28.2751 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
24.1879 -29.9186 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 2 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
6 14 2 0
3 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
19 21 1 0
21 22 1 0
18 23 1 0
23 24 1 0
17 25 1 0
25 26 1 0
2 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
31 33 1 0
30 34 1 0
34 35 1 0
12 36 1 0
11 37 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 547.37Molecular Weight (Monoisotopic): 546.0873AlogP: 5.67#Rotatable Bonds: 8Polar Surface Area: 96.73Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.24CX Basic pKa: ┄CX LogP: 5.63CX LogD: 5.63Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.30Np Likeness Score: -1.66
References 1. Mustafa M, Anwar S, Elgamal F, Ahmed ER, Aly OM.. (2019) Potent combretastatin A-4 analogs containing 1,2,4-triazole: Synthesis, antiproliferative, anti-tubulin activity, and docking study., 183 [PMID:31536891 ] [10.1016/j.ejmech.2019.111697 ]