2-(4-bromo-2-fluorophenylamino)-3,4-difluoro-N-(3-hydroxypropoxy)benzamide

ID: ALA4530560

PubChem CID: 155545952

Max Phase: Preclinical

Molecular Formula: C16H14BrF3N2O3

Molecular Weight: 419.20

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(NOCCCO)c1ccc(F)c(F)c1Nc1ccc(Br)cc1F

Standard InChI:  InChI=1S/C16H14BrF3N2O3/c17-9-2-5-13(12(19)8-9)21-15-10(3-4-11(18)14(15)20)16(24)22-25-7-1-6-23/h2-5,8,21,23H,1,6-7H2,(H,22,24)

Standard InChI Key:  PHDRHLYQOXYTSF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 26  0  0  0  0  0  0  0  0999 V2000
    7.1181   -2.2617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1169   -3.0812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8250   -3.4902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5346   -3.0807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5318   -2.2581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8232   -1.8528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8247   -4.3074    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5324   -4.7161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5280   -5.5316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2348   -5.9402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9436   -5.5318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9412   -4.7103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2338   -4.3054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4089   -3.4893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7015   -3.0801    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4082   -4.3064    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9935   -3.4881    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9928   -4.3053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2848   -4.7134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2841   -5.5306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5761   -5.9386    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8191   -5.9380    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.2430   -3.4882    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.2379   -1.8468    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.6517   -5.9396    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  2 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
  9 22  1  0
  4 23  1  0
  5 24  1  0
 11 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4530560

    ---

Associated Targets(Human)

MAP2K1 Tclin Dual specificity mitogen-activated protein kinase kinase 1 (4127 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 419.20Molecular Weight (Monoisotopic): 418.0140AlogP: 3.65#Rotatable Bonds: 7
Polar Surface Area: 70.59Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 11.99CX Basic pKa: CX LogP: 4.51CX LogD: 4.51
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.47Np Likeness Score: -1.21

References

1. Bauer MR, Mackey MD..  (2019)  Electrostatic Complementarity as a Fast and Effective Tool to Optimize Binding and Selectivity of Protein-Ligand Complexes.,  62  (6): [PMID:30807144] [10.1021/acs.jmedchem.8b01925]

Source