1-(1-Acetylpiperidin-4-yl)-3-(diamant-3-yl)urea

ID: ALA4530604

PubChem CID: 155546214

Max Phase: Preclinical

Molecular Formula: C22H33N3O2

Molecular Weight: 371.53

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)N1CCC(NC(=O)NC2C3CC4C5CC6CC4C2C(C6)C5C3)CC1

Standard InChI:  InChI=1S/C22H33N3O2/c1-11(26)25-4-2-14(3-5-25)23-22(27)24-21-13-9-16-15-6-12-7-18(16)20(21)19(8-12)17(15)10-13/h12-21H,2-10H2,1H3,(H2,23,24,27)

Standard InChI Key:  WIKPLERXRBKKHT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 32  0  0  0  0  0  0  0  0999 V2000
   33.8538  -10.0048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4890   -9.3276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6465   -9.7819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1895   -9.5878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3962  -10.0818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9302   -9.4040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6438   -8.9416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1951   -8.2858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4845   -8.5397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9401   -8.5929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3555   -8.5929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0633   -8.1843    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.6478   -8.1843    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.3555   -9.4101    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.7710   -8.5929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8474  -10.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3910  -10.8959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5532  -11.2302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1929  -10.4790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7647   -9.4065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4684   -9.8150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1785   -9.4099    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.1805   -8.5918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4723   -8.1787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8846   -9.8212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8816  -10.6383    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.5939   -9.4152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  2  4  1  0
  3  5  1  0
  4  6  1  0
  5  6  1  0
  7  8  1  0
  3  7  1  0
  2  9  1  0
  6 10  1  0
 10  8  1  0
  8  9  1  0
 11 12  1  0
 11 13  1  0
 11 14  2  0
 15 12  1  0
 13 10  1  0
  1 16  1  0
  5 17  1  0
 16 18  1  0
 18 17  1  0
  4 19  1  0
 19 18  1  0
 15 20  1  0
 15 24  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 22 25  1  0
 25 26  2  0
 25 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4530604

    ---

Associated Targets(Human)

EPHX2 Tchem Epoxide hydratase (3844 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Ephx2 Epoxide hydratase (467 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 371.53Molecular Weight (Monoisotopic): 371.2573AlogP: 2.61#Rotatable Bonds: 2
Polar Surface Area: 61.44Molecular Species: NEUTRALHBA: 2HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 0.43CX LogP: 0.73CX LogD: 0.73
Aromatic Rings: Heavy Atoms: 27QED Weighted: 0.78Np Likeness Score: -0.38

References

1. Codony S, Valverde E, Leiva R, Brea J, Isabel Loza M, Morisseau C, Hammock BD, Vázquez S..  (2019)  Exploring the size of the lipophilic unit of the soluble epoxide hydrolase inhibitors.,  27  (20): [PMID:31488357] [10.1016/j.bmc.2019.115078]

Source