The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-Cyclopropylmethyl-7alpha-4'-piperazinylphenyl-6,14-endoethanotetrahydronorthebaine ID: ALA4530627
PubChem CID: 155545981
Max Phase: Preclinical
Molecular Formula: C34H43N3O3
Molecular Weight: 541.74
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2c3c1O[C@H]1[C@@]4(OC)CC[C@@]5(C[C@@H]4c4ccc(N6CCNCC6)cc4)[C@@H](C2)N(CC2CC2)CC[C@]315
Standard InChI: InChI=1S/C34H43N3O3/c1-38-27-10-7-24-19-28-32-11-12-34(39-2,26(20-32)23-5-8-25(9-6-23)36-17-14-35-15-18-36)31-33(32,29(24)30(27)40-31)13-16-37(28)21-22-3-4-22/h5-10,22,26,28,31,35H,3-4,11-21H2,1-2H3/t26-,28-,31-,32-,33+,34-/m1/s1
Standard InChI Key: QFPCEQCOHXGVAG-DPODCYPTSA-N
Molfile:
RDKit 2D
42 50 0 0 0 0 0 0 0 0999 V2000
18.6592 -14.2596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8461 -14.2596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0719 -13.5538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4499 -14.9529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0595 -14.9529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2176 -15.4358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.6386 -12.8481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4499 -13.5538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8850 -13.5538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8461 -12.8481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6592 -12.0309 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2424 -13.5497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2936 -14.2637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8767 -14.9653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6327 -14.9529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2424 -12.5468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6327 -13.5538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2200 -14.2596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2118 -15.6711 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.2812 -15.6793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0678 -11.3086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0554 -15.8651 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
19.3402 -12.4395 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
15.3863 -15.6651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1066 -15.6856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1190 -14.2683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5256 -14.9843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3503 -14.9893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7678 -14.2793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3548 -13.5586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5314 -13.5571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1875 -14.3669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8313 -14.2596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8850 -11.3014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5907 -11.7045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5835 -10.8873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5850 -14.2838 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.9845 -14.9932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7981 -14.9997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2145 -14.2961 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.8111 -13.5844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9913 -13.5762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 2 2 0
5 1 1 0
6 5 1 0
7 3 1 0
8 2 1 0
9 3 1 0
10 7 1 0
11 16 1 0
1 12 1 1
13 14 1 0
14 5 1 0
15 4 1 0
16 12 1 0
17 8 2 0
18 17 1 0
19 15 1 0
14 20 1 6
21 11 1 0
5 22 1 1
7 23 1 6
4 6 1 0
7 11 1 0
9 13 1 0
8 10 1 0
18 15 2 0
19 24 1 0
20 25 1 0
13 26 1 6
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
3 32 1 6
32 33 1 0
14 33 1 0
21 34 1 0
35 34 1 0
36 35 1 0
34 36 1 0
29 37 1 0
37 38 1 0
37 42 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 42 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 541.74Molecular Weight (Monoisotopic): 541.3304AlogP: 4.50#Rotatable Bonds: 6Polar Surface Area: 46.20Molecular Species: BASEHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 10.13CX LogP: 4.32CX LogD: 0.18Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.58Np Likeness Score: 0.75
References 1. Xiao L, Wang Y, Zhang M, Wu W, Kong L, Ma Y, Xu X, Liu X, He Q, Qian Y, Sun H, Wu H, Lin C, Huang H, Ye R, Jiang S, Ye RF, Yuan C, Fang S, Xue D, Yang X, Chen H, Zheng Y, Yu L, Xie Q, Zheng L, Fu W, Li W, Qiu Z, Liu J, Shao L.. (2019) Discovery of a Highly Selective and Potent κ Opioid Receptor Agonist from N -Cyclopropylmethyl-7α-phenyl-6,14-endoethanotetrahydronorthebaines with Reduced Central Nervous System (CNS) Side Effects Navigated by the Message-Address Concept., 62 (24): [PMID:31738550 ] [10.1021/acs.jmedchem.9b00857 ]