The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-Cyclopropylmethyl-7alpha-4'-(N'',N''-dimethylaminopropyl)aminophenyl-6,14-endoethanotetrahydronorthebaine ID: ALA4530660
PubChem CID: 155546186
Max Phase: Preclinical
Molecular Formula: C35H47N3O3
Molecular Weight: 557.78
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2c3c1O[C@H]1[C@@]4(OC)CC[C@@]5(C[C@@H]4c4ccc(NCCCN(C)C)cc4)[C@@H](C2)N(CC2CC2)CC[C@]315
Standard InChI: InChI=1S/C35H47N3O3/c1-37(2)18-5-17-36-26-11-8-24(9-12-26)27-21-33-14-15-35(27,40-4)32-34(33)16-19-38(22-23-6-7-23)29(33)20-25-10-13-28(39-3)31(41-32)30(25)34/h8-13,23,27,29,32,36H,5-7,14-22H2,1-4H3/t27-,29-,32-,33-,34+,35-/m1/s1
Standard InChI Key: XCBYRMBIVBLEKI-YSZDWGKDSA-N
Molfile:
RDKit 2D
43 50 0 0 0 0 0 0 0 0999 V2000
31.0203 -24.9862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2072 -24.9862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4330 -24.2805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8110 -25.6796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4206 -25.6796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5786 -26.1625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.9996 -23.5747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8110 -24.2805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2460 -24.2805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2072 -23.5747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0203 -22.7575 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.6034 -24.2764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6546 -24.9904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2378 -25.6920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9938 -25.6796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6034 -23.2734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9938 -24.2805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5811 -24.9862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5728 -26.3978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.6423 -26.4060 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.4288 -22.0353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4165 -26.5917 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
31.7012 -23.1661 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
27.7474 -26.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4677 -26.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4801 -24.9950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8867 -25.7110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7113 -25.7160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1289 -25.0060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7158 -24.2853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8925 -24.2838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5485 -25.0935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1924 -24.9862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2460 -22.0281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9517 -22.4312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9445 -21.6140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9461 -25.0105 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.3507 -25.7205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1679 -25.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5725 -26.4350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3897 -26.4395 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.7944 -27.1495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8022 -25.7341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 2 2 0
5 1 1 0
6 5 1 0
7 3 1 0
8 2 1 0
9 3 1 0
10 7 1 0
11 16 1 0
1 12 1 1
13 14 1 0
14 5 1 0
15 4 1 0
16 12 1 0
17 8 2 0
18 17 1 0
19 15 1 0
14 20 1 6
21 11 1 0
5 22 1 1
7 23 1 6
4 6 1 0
7 11 1 0
9 13 1 0
8 10 1 0
18 15 2 0
19 24 1 0
20 25 1 0
13 26 1 6
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
3 32 1 6
32 33 1 0
14 33 1 0
21 34 1 0
35 34 1 0
36 35 1 0
34 36 1 0
29 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 42 1 0
41 43 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 557.78Molecular Weight (Monoisotopic): 557.3617AlogP: 5.45#Rotatable Bonds: 10Polar Surface Area: 46.20Molecular Species: BASEHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 10.18CX LogP: 4.30CX LogD: -0.34Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.39Np Likeness Score: 0.61
References 1. Xiao L, Wang Y, Zhang M, Wu W, Kong L, Ma Y, Xu X, Liu X, He Q, Qian Y, Sun H, Wu H, Lin C, Huang H, Ye R, Jiang S, Ye RF, Yuan C, Fang S, Xue D, Yang X, Chen H, Zheng Y, Yu L, Xie Q, Zheng L, Fu W, Li W, Qiu Z, Liu J, Shao L.. (2019) Discovery of a Highly Selective and Potent κ Opioid Receptor Agonist from N -Cyclopropylmethyl-7α-phenyl-6,14-endoethanotetrahydronorthebaines with Reduced Central Nervous System (CNS) Side Effects Navigated by the Message-Address Concept., 62 (24): [PMID:31738550 ] [10.1021/acs.jmedchem.9b00857 ]