N-Cyclopropylmethyl-7alpha-4'-(N'',N''-dimethylaminopropyl)aminophenyl-6,14-endoethanotetrahydronorthebaine

ID: ALA4530660

PubChem CID: 155546186

Max Phase: Preclinical

Molecular Formula: C35H47N3O3

Molecular Weight: 557.78

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc2c3c1O[C@H]1[C@@]4(OC)CC[C@@]5(C[C@@H]4c4ccc(NCCCN(C)C)cc4)[C@@H](C2)N(CC2CC2)CC[C@]315

Standard InChI:  InChI=1S/C35H47N3O3/c1-37(2)18-5-17-36-26-11-8-24(9-12-26)27-21-33-14-15-35(27,40-4)32-34(33)16-19-38(22-23-6-7-23)29(33)20-25-10-13-28(39-3)31(41-32)30(25)34/h8-13,23,27,29,32,36H,5-7,14-22H2,1-4H3/t27-,29-,32-,33-,34+,35-/m1/s1

Standard InChI Key:  XCBYRMBIVBLEKI-YSZDWGKDSA-N

Molfile:  

 
     RDKit          2D

 43 50  0  0  0  0  0  0  0  0999 V2000
   31.0203  -24.9862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2072  -24.9862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4330  -24.2805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8110  -25.6796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4206  -25.6796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5786  -26.1625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.9996  -23.5747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8110  -24.2805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2460  -24.2805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2072  -23.5747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0203  -22.7575    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.6034  -24.2764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6546  -24.9904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2378  -25.6920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9938  -25.6796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6034  -23.2734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9938  -24.2805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5811  -24.9862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5728  -26.3978    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.6423  -26.4060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.4288  -22.0353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4165  -26.5917    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   31.7012  -23.1661    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   27.7474  -26.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4677  -26.4122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4801  -24.9950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8867  -25.7110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7113  -25.7160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1289  -25.0060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7158  -24.2853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8925  -24.2838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5485  -25.0935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1924  -24.9862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2460  -22.0281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9517  -22.4312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9445  -21.6140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9461  -25.0105    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.3507  -25.7205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1679  -25.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5725  -26.4350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3897  -26.4395    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.7944  -27.1495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8022  -25.7341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  2  2  0
  5  1  1  0
  6  5  1  0
  7  3  1  0
  8  2  1  0
  9  3  1  0
 10  7  1  0
 11 16  1  0
  1 12  1  1
 13 14  1  0
 14  5  1  0
 15  4  1  0
 16 12  1  0
 17  8  2  0
 18 17  1  0
 19 15  1  0
 14 20  1  6
 21 11  1  0
  5 22  1  1
  7 23  1  6
  4  6  1  0
  7 11  1  0
  9 13  1  0
  8 10  1  0
 18 15  2  0
 19 24  1  0
 20 25  1  0
 13 26  1  6
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
  3 32  1  6
 32 33  1  0
 14 33  1  0
 21 34  1  0
 35 34  1  0
 36 35  1  0
 34 36  1  0
 29 37  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 41 42  1  0
 41 43  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4530660

    ---

Associated Targets(Human)

OPRK1 Tclin Kappa opioid receptor (16155 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Oprm1 Mu opioid receptor (6060 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Oprd1 Delta opioid receptor (3911 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 557.78Molecular Weight (Monoisotopic): 557.3617AlogP: 5.45#Rotatable Bonds: 10
Polar Surface Area: 46.20Molecular Species: BASEHBA: 6HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 10.18CX LogP: 4.30CX LogD: -0.34
Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.39Np Likeness Score: 0.61

References

1. Xiao L, Wang Y, Zhang M, Wu W, Kong L, Ma Y, Xu X, Liu X, He Q, Qian Y, Sun H, Wu H, Lin C, Huang H, Ye R, Jiang S, Ye RF, Yuan C, Fang S, Xue D, Yang X, Chen H, Zheng Y, Yu L, Xie Q, Zheng L, Fu W, Li W, Qiu Z, Liu J, Shao L..  (2019)  Discovery of a Highly Selective and Potent κ Opioid Receptor Agonist from N-Cyclopropylmethyl-7α-phenyl-6,14-endoethanotetrahydronorthebaines with Reduced Central Nervous System (CNS) Side Effects Navigated by the Message-Address Concept.,  62  (24): [PMID:31738550] [10.1021/acs.jmedchem.9b00857]

Source