(R)-1-([1,1'-biphenyl]-4-ylmethyl)-6-fluoro-7-(3-(hydroxymethyl)pyrrolidin-1-yl)-8-methoxy-4-oxo-1,4-dihydroquinoline-3-carboxylic acid

ID: ALA4530742

PubChem CID: 134603975

Max Phase: Preclinical

Molecular Formula: C29H27FN2O5

Molecular Weight: 502.54

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1c(N2CC[C@@H](CO)C2)c(F)cc2c(=O)c(C(=O)O)cn(Cc3ccc(-c4ccccc4)cc3)c12

Standard InChI:  InChI=1S/C29H27FN2O5/c1-37-28-25-22(13-24(30)26(28)31-12-11-19(15-31)17-33)27(34)23(29(35)36)16-32(25)14-18-7-9-21(10-8-18)20-5-3-2-4-6-20/h2-10,13,16,19,33H,11-12,14-15,17H2,1H3,(H,35,36)/t19-/m1/s1

Standard InChI Key:  NUVXOQFCNOHVBW-LJQANCHMSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
    4.2950  -16.8886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2939  -17.7081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0019  -18.1171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0001  -16.4797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7088  -16.8850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7076  -17.7056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4138  -18.1147    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1257  -17.7076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1268  -16.8870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4161  -16.4734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4161  -15.6562    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8355  -16.4801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5422  -16.8904    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8375  -15.6629    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4115  -18.9319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1181  -19.3424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1144  -20.1584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8202  -20.5689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5300  -20.1623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5297  -19.3408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8233  -18.9341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2353  -20.5701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2328  -21.3884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9391  -21.7979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6484  -21.3903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6469  -20.5689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9401  -20.1630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0036  -18.9343    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2967  -19.3443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5859  -18.1162    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5872  -16.4802    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.8381  -17.7846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2908  -18.3915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6989  -19.0996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4983  -18.9302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4776  -18.3047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9959  -18.9666    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
  9 12  1  0
 12 13  1  0
 12 14  2  0
  7 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 19 22  1  0
  3 28  1  0
 28 29  1  0
  2 30  1  0
  1 31  1  0
 30 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 30  1  0
 36 37  1  0
 33 36  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4530742

    ---

Associated Targets(Human)

TOP1 Tclin DNA topoisomerase I (7553 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 502.54Molecular Weight (Monoisotopic): 502.1904AlogP: 4.38#Rotatable Bonds: 7
Polar Surface Area: 92.00Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 6.05CX Basic pKa: CX LogP: 4.21CX LogD: 2.85
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.39Np Likeness Score: -0.55

References

1. Delgado JL, Lentz SRC, Kulkarni CA, Chheda PR, Held HA, Hiasa H, Kerns RJ..  (2019)  Probing structural requirements for human topoisomerase I inhibition by a novel N1-Biphenyl fluoroquinolone.,  172  [PMID:30959322] [10.1016/j.ejmech.2019.03.040]

Source