10-(6-fluoropyridin-3-yl)-3-methoxy-6-methylspiro[benzo[c]pyrido[3,2-e]azepine-7,1'-cyclopropan]-5(6H)-one

ID: ALA4530783

PubChem CID: 142469540

Max Phase: Preclinical

Molecular Formula: C22H18FN3O2

Molecular Weight: 375.40

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc2c(n1)C(=O)N(C)C1(CC1)c1ccc(-c3ccc(F)nc3)cc1-2

Standard InChI:  InChI=1S/C22H18FN3O2/c1-26-21(27)20-15(5-8-19(25-20)28-2)16-11-13(14-4-7-18(23)24-12-14)3-6-17(16)22(26)9-10-22/h3-8,11-12H,9-10H2,1-2H3

Standard InChI Key:  SDOAZYAZKGQRRD-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 32  0  0  0  0  0  0  0  0999 V2000
    5.6791  -10.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3889  -10.6524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3879   -9.8333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3322  -11.1765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3310  -11.9960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0391  -12.4050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0373  -10.7676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7452  -11.9952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7459  -11.1729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1972  -10.8335    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5544  -11.5771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6249  -12.4043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9172  -11.9935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2097  -12.4008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2086  -13.2189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9209  -13.6279    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6256  -13.2182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7052  -10.1934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3716  -11.5753    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5011  -13.6279    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.1991  -12.3211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3938  -12.5112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1573  -13.3022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7251  -13.9037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5326  -13.7090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7653  -12.9183    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0959  -14.3009    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8649  -15.0848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  1  3  1  0
  4  5  2  0
  5  6  1  0
  6  8  2  0
  9  7  2  0
  7  4  1  0
  8  9  1  0
  9  2  1  0
  8 22  1  0
  2 10  1  0
 10 11  1  0
 21 11  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  5 12  1  0
 10 18  1  0
 11 19  2  0
 15 20  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 25 27  1  0
 27 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4530783

    ---

Associated Targets(Human)

GRM3 Tchem Metabotropic glutamate receptor 3 (732 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 375.40Molecular Weight (Monoisotopic): 375.1383AlogP: 4.03#Rotatable Bonds: 2
Polar Surface Area: 55.32Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 0.64CX LogP: 3.63CX LogD: 3.63
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.63Np Likeness Score: -0.32

References

1. Kargbo RB..  (2019)  Allosteric mGluR3 Modulators for the Treatment of Psychiatric Disorders.,  10  (2): [PMID:30783491] [10.1021/acsmedchemlett.8b00619]

Source