Ethyl 2-(3-(4-fluorobenzamido)phenyl)-4-((4-(morpholine-4-carbonyl)phenyl)amino)thiazole-5-carboxylate

ID: ALA4530794

PubChem CID: 155545977

Max Phase: Preclinical

Molecular Formula: C30H27FN4O5S

Molecular Weight: 574.63

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)c1sc(-c2cccc(NC(=O)c3ccc(F)cc3)c2)nc1Nc1ccc(C(=O)N2CCOCC2)cc1

Standard InChI:  InChI=1S/C30H27FN4O5S/c1-2-40-30(38)25-26(32-23-12-8-20(9-13-23)29(37)35-14-16-39-17-15-35)34-28(41-25)21-4-3-5-24(18-21)33-27(36)19-6-10-22(31)11-7-19/h3-13,18,32H,2,14-17H2,1H3,(H,33,36)

Standard InChI Key:  WXXCNLLNFZMAPE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 41 45  0  0  0  0  0  0  0  0999 V2000
   15.0443  -16.6208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0432  -17.4481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7580  -17.8610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4745  -17.4476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4715  -16.6171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7562  -16.2080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1845  -16.2019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9005  -16.6117    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.1814  -15.3769    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.6134  -16.1965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3279  -16.6098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0403  -16.1952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0376  -15.3694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3166  -14.9597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6071  -15.3766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7561  -16.6054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8417  -17.4238    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.6491  -17.5926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0593  -16.8767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5053  -16.2656    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   21.9872  -18.3452    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.8080  -18.4287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1427  -19.1799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9626  -19.2637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4462  -18.5941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1040  -17.8388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2850  -17.7586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8809  -16.7851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3681  -17.4509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.2139  -16.0304    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.0341  -15.9413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3671  -15.1866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2671  -18.6766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6061  -19.4287    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.7489  -18.0070    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.1227  -20.0933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4585  -20.8430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2792  -20.9297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.7633  -20.2604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4265  -19.5044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3284  -17.8600    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
 12 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 16  1  0
 18 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 28 29  2  0
 28 30  1  0
 19 28  1  0
 30 31  1  0
 31 32  1  0
 25 33  1  0
 33 34  1  0
 33 35  2  0
 34 36  1  0
 34 40  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
  2 41  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4530794

    ---

Associated Targets(Human)

Raji (5516 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Ramos (1218 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BTK Tclin Tyrosine-protein kinase BTK (8973 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 574.63Molecular Weight (Monoisotopic): 574.1686AlogP: 5.59#Rotatable Bonds: 8
Polar Surface Area: 109.86Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.24CX Basic pKa: CX LogP: 6.80CX LogD: 6.80
Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.26Np Likeness Score: -1.92

References

1. Guo X, Yang D, Fan Z, Zhang N, Zhao B, Huang C, Wang F, Ma R, Meng M, Deng Y..  (2019)  Discovery and structure-activity relationship of novel diphenylthiazole derivatives as BTK inhibitor with potent activity against B cell lymphoma cell lines.,  178  [PMID:31234030] [10.1016/j.ejmech.2019.06.035]

Source